missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,2-Bis(4-aminophenyl)hexafluoropropane 98.0+%, TCI America™
$145.98 - $1,367.02
Chemical Identifiers
| CAS | 1095-78-9 |
|---|---|
| Molecular Formula | C15H12F6N2 |
| Molecular Weight (g/mol) | 334.265 |
| MDL Number | MFCD00039146 |
| InChI Key | BEKFRNOZJSYWKZ-UHFFFAOYSA-N |
| Synonym | 2,2-bis 4-aminophenyl hexafluoropropane, 4,4'-perfluoropropane-2,2-diyl dianiline, 4,4'-hexafluoroisopropylidene dianiline, 4-2-4-aminophenyl-1,1,1,3,3,3-hexafluoropropan-2-yl aniline, benzenamine, 4,4'-2,2,2-trifluoro-1-trifluoromethyl ethylidene bis, acmc-1bon7, bekfrnozjsywkz-uhfffaoysa, 2,2-bis-4-aminophenyl hexafluoropropane, 4,4'-1,1,1,3,3,3-hexafluoropropane-2,2-diyl dianiline |
| PubChem CID | 622236 |
| IUPAC Name | 4-[2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]aniline |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)N)(C(F)(F)F)C(F)(F)F)N |
Chemical Identifiers
| 1095-78-9 | |
| 334.265 | |
| BEKFRNOZJSYWKZ-UHFFFAOYSA-N | |
| 622236 | |
| C1=CC(=CC=C1C(C2=CC=C(C=C2)N)(C(F)(F)F)C(F)(F)F)N |
| C15H12F6N2 | |
| MFCD00039146 | |
| 2,2-bis 4-aminophenyl hexafluoropropane, 4,4'-perfluoropropane-2,2-diyl dianiline, 4,4'-hexafluoroisopropylidene dianiline, 4-2-4-aminophenyl-1,1,1,3,3,3-hexafluoropropan-2-yl aniline, benzenamine, 4,4'-2,2,2-trifluoro-1-trifluoromethyl ethylidene bis, acmc-1bon7, bekfrnozjsywkz-uhfffaoysa, 2,2-bis-4-aminophenyl hexafluoropropane, 4,4'-1,1,1,3,3,3-hexafluoropropane-2,2-diyl dianiline | |
| 4-[2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]aniline |
Specifications
| 1095-78-9 | |
| White-Yellow | |
| MFCD00039146 | |
| 2,2-bis 4-aminophenyl hexafluoropropane, 4,4'-perfluoropropane-2,2-diyl dianiline, 4,4'-hexafluoroisopropylidene dianiline, 4-2-4-aminophenyl-1,1,1,3,3,3-hexafluoropropan-2-yl aniline, benzenamine, 4,4'-2,2,2-trifluoro-1-trifluoromethyl ethylidene bis, acmc-1bon7, bekfrnozjsywkz-uhfffaoysa, 2,2-bis-4-aminophenyl hexafluoropropane, 4,4'-1,1,1,3,3,3-hexafluoropropane-2,2-diyl dianiline | |
| C1=CC(=CC=C1C(C2=CC=C(C=C2)N)(C(F)(F)F)C(F)(F)F)N | |
| 334.265 | |
| 334.27 | |
| Crystalline Powder |
| 198°C | |
| C15H12F6N2 | |
| 1 g | |
| BEKFRNOZJSYWKZ-UHFFFAOYSA-N | |
| 4-[2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]aniline | |
| 622236 | |
| ≥98.0% (GC,T) | |
| 2,2-Bis(4-aminophenyl)hexafluoropropane |
Safety and Handling
TSCA : Yes