missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,2,6,6-Tetramethyl-3,5-heptanedione, 98%
CAS: 1118-71-4 | C11H20O2 | 184.28 g/mol
$107.22 - $107.22
Chemical Identifiers
| CAS | 1118-71-4 |
|---|---|
| Molecular Formula | C11H20O2 |
| Molecular Weight (g/mol) | 184.28 |
| InChI Key | YRAJNWYBUCUFBD-UHFFFAOYSA-N |
| Synonym | dipivaloylmethane, 2,2,6,6-tetramethyl-3,5-heptanedione, 3,5-heptanedione, 2,2,6,6-tetramethyl, unii-r8ui909hoy, tmhd, 2,2,6,6-tetramethyl-3,5-heptanedione dipivaloylmethane, r8ui909hoy, 2,2,6,6-tetramethyl-heptane-3,5-dione, pubchem12497 |
| PubChem CID | 70700 |
| IUPAC Name | 2,2,6,6-tetramethylheptane-3,5-dione |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC168320050
|
Thermo Scientific Chemicals
168320050 |
5 g | Glass bottle |
Each for $107.22
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Acylation reagentChemical Identifiers
| 1118-71-4 | |
| 184.28 | |
| dipivaloylmethane, 2,2,6,6-tetramethyl-3,5-heptanedione, 3,5-heptanedione, 2,2,6,6-tetramethyl, unii-r8ui909hoy, tmhd, 2,2,6,6-tetramethyl-3,5-heptanedione dipivaloylmethane, r8ui909hoy, 2,2,6,6-tetramethyl-heptane-3,5-dione, pubchem12497 | |
| 2,2,6,6-tetramethylheptane-3,5-dione |
| C11H20O2 | |
| YRAJNWYBUCUFBD-UHFFFAOYSA-N | |
| 70700 | |
| CC(C)(C)C(=O)CC(=O)C(C)(C)C |
Specifications
| 1118-71-4 | |
| 0.8800g/mL | |
| 67°C | |
| 98% | |
| C11H20O2 | |
| (CH3)3CCOCH2COC(CH3)3 | |
| 01,III,3149 | |
| dipivaloylmethane, 2,2,6,6-tetramethyl-3,5-heptanedione, 3,5-heptanedione, 2,2,6,6-tetramethyl, unii-r8ui909hoy, tmhd, 2,2,6,6-tetramethyl-3,5-heptanedione dipivaloylmethane, r8ui909hoy, 2,2,6,6-tetramethyl-heptane-3,5-dione, pubchem12497 | |
| YRAJNWYBUCUFBD-UHFFFAOYSA-N | |
| 2,2,6,6-tetramethylheptane-3,5-dione | |
| 70700 | |
| 98% | |
| 2,2,6,6-Tetramethyl-3,5-heptanedione |
| Colorless to Yellow | |
| 72.0°C to 73.0°C (6.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4579 to 1.4599 | |
| 5 g | |
| 0.88 | |
| Solubility in water: insoluble. | |
| CC(C)(C)C(=O)CC(=O)C(C)(C)C | |
| 184.28 | |
| 184.28 | |
| Liquid |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 214-268-3
RUO – Research Use Only