Learn More
2,2':6',2″-Terpyridine, 96%
CAS: 1148-79-4 | C15H11N3 | 233.27 g/mol
$98.97 - $274.02
Chemical Identifiers
| CAS | 1148-79-4 |
|---|---|
| Molecular Formula | C15H11N3 |
| Molecular Weight (g/mol) | 233.27 |
| MDL Number | MFCD00006213 |
| InChI Key | DRGAZIDRYFYHIJ-UHFFFAOYSA-N |
| Synonym | 2,2':6',2-terpyridine, tripyridyl, tripyridine, 2,6-bis 2-pyridyl pyridine, terpy, terpyridine, 2,2',2-terpyridine, 2,2',2-terpyridyl, 2,2',2-tripyridyl, 2,2',2-tripyridine |
| PubChem CID | 70848 |
| ChEBI | CHEBI:245199 |
| IUPAC Name | 2,6-dipyridin-2-ylpyridine |
| SMILES | C1=CC=C(N=C1)C1=CC=CC(=N1)C1=CC=CC=N1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC215632500
|
Thermo Scientific Chemicals
215632500 |
250 mg |
Each for $98.97
|
|
|||||
|
AC215630010
|
Thermo Scientific Chemicals
215630010 |
1 g |
Each for $274.02
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1148-79-4 | |
| 233.27 | |
| DRGAZIDRYFYHIJ-UHFFFAOYSA-N | |
| 70848 | |
| 2,6-dipyridin-2-ylpyridine |
| C15H11N3 | |
| MFCD00006213 | |
| 2,2':6',2-terpyridine, tripyridyl, tripyridine, 2,6-bis 2-pyridyl pyridine, terpy, terpyridine, 2,2',2-terpyridine, 2,2',2-terpyridyl, 2,2',2-tripyridyl, 2,2',2-tripyridine | |
| CHEBI:245199 | |
| C1=CC=C(N=C1)C1=CC=CC(=N1)C1=CC=CC=N1 |
Specifications
| 1148-79-4 | |
| 370.0°C | |
| 95% min. (GC) | |
| MFCD00006213 | |
| 2,2':6',2-terpyridine, tripyridyl, tripyridine, 2,6-bis 2-pyridyl pyridine, terpy, terpyridine, 2,2',2-terpyridine, 2,2',2-terpyridyl, 2,2',2-tripyridyl, 2,2',2-tripyridine | |
| C1=CC=C(N=C1)C1=CC=CC(=N1)C1=CC=CC=N1 | |
| 233.27 | |
| CHEBI:245199 | |
| 96% |
| 89.0°C to 91.0°C | |
| Authentic | |
| C15H11N3 | |
| 250 mg | |
| DRGAZIDRYFYHIJ-UHFFFAOYSA-N | |
| 2,6-dipyridin-2-ylpyridine | |
| 70848 | |
| 233.28 | |
| 2,2':6',2''-Terpyridine |
Safety and Handling
GHS H Statement
Fatal if swallowed.
Fatal in contact with skin.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
IF ON SKIN: Wash with plenty of soap and water.
IF exposed or concerned:
GHS Signal Word: Danger
EINECSNumber : 214-559-5
RUO – Research Use Only