missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,2,3,4,4,4-Hexafluorobutyl Methacrylate (stabilized with MEHQ) 98.0+%, TCI America™
Supplier: TCI America H155525G
Specifications
| 2,2,3,4,4,4-Hexafluorobutyl Methacrylate (stabilized with MEHQ) | |
| Colorless | |
| C8H8F6O2 | |
| 25 g | |
| 2,2,3,4,4,4-hexafluorobutyl methacrylate, 1h,1h,3h-hexafluorobutyl methacrylate, hexafluorobutyl methacrylate, methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester, 2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, hexafluorobutyl methacrylate polymer, hfbma, acmc-1adv6, ksc489s1j, 2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer | |
| CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F | |
| 250.14 | |
| 250.14 | |
| Liquid |
| 36405-47-7 | |
| 158°C | |
| MFCD00042311 | |
| 3272 | |
| DFVPUWGVOPDJTC-UHFFFAOYSA-N | |
| 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate | |
| 549772 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 36405-47-7 | |
| 250.14 | |
| DFVPUWGVOPDJTC-UHFFFAOYSA-N | |
| 549772 | |
| CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F |
| C8H8F6O2 | |
| MFCD00042311 | |
| 2,2,3,4,4,4-hexafluorobutyl methacrylate, 1h,1h,3h-hexafluorobutyl methacrylate, hexafluorobutyl methacrylate, methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester, 2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, hexafluorobutyl methacrylate polymer, hfbma, acmc-1adv6, ksc489s1j, 2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer | |
| 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate |
Safety and Handling
TSCA : No