missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1H,1H,5H-Octafluoropentyl Methacrylate (stabilized with MEHQ) 98.0+%, TCI America™
$80.16 - $221.83
Chemical Identifiers
| CAS | 355-93-1 |
|---|---|
| Molecular Formula | C9H8F8O2 |
| Molecular Weight (g/mol) | 300.15 |
| MDL Number | MFCD00039278 |
| InChI Key | ZNJXRXXJPIFFAO-UHFFFAOYSA-N |
| Synonym | 1h,1h,5h-octafluoropentyl methacrylate, 2,2,3,3,4,4,5,5-octafluoropentyl methacrylate, octafluoropentyl methacrylate, 1h,1h,5h-perfluoropentyl methacrylate, 1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq, 2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester, methacrylic acid 1h,1h,5h-perfluoropentyl ester, methacrylic acid 1h,1h,5h-octafluoropentyl ester, octafluoropentyl methacrylate polymer, 1h,1h,5h-octafluoropentylmethacrylate |
| PubChem CID | 67739 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate |
| SMILES | CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
Chemical Identifiers
| 355-93-1 | |
| 300.15 | |
| ZNJXRXXJPIFFAO-UHFFFAOYSA-N | |
| 67739 | |
| CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| C9H8F8O2 | |
| MFCD00039278 | |
| 1h,1h,5h-octafluoropentyl methacrylate, 2,2,3,3,4,4,5,5-octafluoropentyl methacrylate, octafluoropentyl methacrylate, 1h,1h,5h-perfluoropentyl methacrylate, 1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq, 2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester, methacrylic acid 1h,1h,5h-perfluoropentyl ester, methacrylic acid 1h,1h,5h-octafluoropentyl ester, octafluoropentyl methacrylate polymer, 1h,1h,5h-octafluoropentylmethacrylate | |
| 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate |
Specifications
| 355-93-1 | |
| 88°C | |
| MFCD00039278 | |
| 1h,1h,5h-octafluoropentyl methacrylate, 2,2,3,3,4,4,5,5-octafluoropentyl methacrylate, octafluoropentyl methacrylate, 1h,1h,5h-perfluoropentyl methacrylate, 1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq, 2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester, methacrylic acid 1h,1h,5h-perfluoropentyl ester, methacrylic acid 1h,1h,5h-octafluoropentyl ester, octafluoropentyl methacrylate polymer, 1h,1h,5h-octafluoropentylmethacrylate | |
| CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F | |
| 300.15 | |
| 300.15 | |
| Liquid |
| Colorless | |
| C9H8F8O2 | |
| 5 g | |
| ZNJXRXXJPIFFAO-UHFFFAOYSA-N | |
| 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate | |
| 67739 | |
| ≥98.0% (GC) | |
| 1H,1H,5H-Octafluoropentyl Methacrylate (stabilized with MEHQ) |
Safety and Handling
TSCA : No