Learn More
12-Hydroxystearic acid, 95%
CAS: 106-14-9 | C18H36O3 | 300.483 g/mol
$53.48 - $587.85
Chemical Identifiers
| CAS | 106-14-9 |
|---|---|
| Molecular Formula | C18H36O3 |
| Molecular Weight (g/mol) | 300.483 |
| MDL Number | MFCD00004592 |
| InChI Key | ULQISTXYYBZJSJ-UHFFFAOYSA-N |
| Synonym | 12-hydroxystearic acid, octadecanoic acid, 12-hydroxy, harwax a, cerit fac 3, hydrofol acid 200, dl-12-hydroxystearic acid, ceroxin gl, barolub fto, loxiol g 21, stearic acid, 12-hydroxy |
| PubChem CID | 7789 |
| ChEBI | CHEBI:85208 |
| IUPAC Name | 12-hydroxyoctadecanoic acid |
| SMILES | CCCCCCC(CCCCCCCCCCC(=O)O)O |
Description
12-Hydroxystearic acid is used in cosmetics, wax blends, heavy duty greases, polishes, inks and hot melt adhesives, as a lubricant for natural and synthetic rubbers and as a source for industrial oleo chemicals. It is also used as an intermediate in pharmaceuticals.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 106-14-9 | |
| 300.483 | |
| ULQISTXYYBZJSJ-UHFFFAOYSA-N | |
| 7789 | |
| 12-hydroxyoctadecanoic acid |
| C18H36O3 | |
| MFCD00004592 | |
| 12-hydroxystearic acid, octadecanoic acid, 12-hydroxy, harwax a, cerit fac 3, hydrofol acid 200, dl-12-hydroxystearic acid, ceroxin gl, barolub fto, loxiol g 21, stearic acid, 12-hydroxy | |
| CHEBI:85208 | |
| CCCCCCC(CCCCCCCCCCC(=O)O)O |
Specifications
| 106-14-9 | |
| White | |
| CH3(CH2)5CH(OH)(CH2)10CO2H | |
| 1 g | |
| 12-hydroxystearic acid, octadecanoic acid, 12-hydroxy, harwax a, cerit fac 3, hydrofol acid 200, dl-12-hydroxystearic acid, ceroxin gl, barolub fto, loxiol g 21, stearic acid, 12-hydroxy | |
| ULQISTXYYBZJSJ-UHFFFAOYSA-N | |
| 12-hydroxyoctadecanoic acid | |
| 7789 | |
| 300.48 | |
| Crystalline |
| 72°C to 76°C | |
| C18H36O3 | |
| MFCD00004592 | |
| 1726730 | |
| Soluble in ether,alcohol and chloroform. Insoluble in water. | |
| CCCCCCC(CCCCCCCCCCC(=O)O)O | |
| 300.483 | |
| CHEBI:85208 | |
| 95% | |
| 12-Hydroxystearic acid |
Safety and Handling
EINECSNumber : 203-366-1
RTECSNumber : W13700000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only