missing translation for 'onlineSavingsMsg'
Learn More
Learn More
11-Deoxycorticosterone acetate, 97%, Thermo Scientific Chemicals
$628.41 - $628.41
Chemical Identifiers
| CAS | 56-47-3 |
|---|---|
| Molecular Formula | C23H32O4 |
| Molecular Weight (g/mol) | 372.51 |
| MDL Number | MFCD00003660 |
| InChI Key | VPGRYOFKCNULNK-ZIUYWEQENA-N |
| Synonym | deoxycorticosterone acetate, desoxycorticosterone acetate, doca, desoxycortone acetate, percotol, cortexone acetate, decosteron, decosterone, sincortex, syncortyl |
| PubChem CID | 5952 |
| ChEBI | CHEBI:34671 |
| SMILES | [H][C@@]12CC[C@H](C(=O)COC(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC460470050
|
Thermo Scientific Chemicals
460470050 |
5 g |
Each for $628.41
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 56-47-3 | |
| 372.51 | |
| VPGRYOFKCNULNK-ZIUYWEQENA-N | |
| 5952 | |
| [H][C@@]12CC[C@H](C(=O)COC(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| C23H32O4 | |
| MFCD00003660 | |
| deoxycorticosterone acetate, desoxycorticosterone acetate, doca, desoxycortone acetate, percotol, cortexone acetate, decosteron, decosterone, sincortex, syncortyl | |
| CHEBI:34671 |
Specifications
| 56-47-3 | |
| 0.5% max. | |
| 96% min. (HPLC) | |
| MFCD00003660 | |
| deoxycorticosterone acetate, desoxycorticosterone acetate, doca, desoxycortone acetate, percotol, cortexone acetate, decosteron, decosterone, sincortex, syncortyl | |
| [H][C@@]12CC[C@H](C(=O)COC(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C | |
| 372.51 | |
| CHEBI:34671 | |
| 97% |
| 154.0°C to 160.0°C | |
| Authentic | |
| C23H32O4 | |
| 5 g | |
| VPGRYOFKCNULNK-ZIUYWEQENA-N | |
| 2-[(1S,3aS,3bS,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-1H,2H,3H,3aH,3bH,4H,5H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-1-yl]-2-oxoethyl acetate | |
| 5952 | |
| 372.5 | |
| 11-Deoxycorticosterone acetate |
Safety and Handling
EINECSNumber : 200-275-9
RUO – Research Use Only