missing translation for 'onlineSavingsMsg'
Learn More
Learn More
10-Phenyl-9-anthraceneboronic Acid (contains varying amounts of Anhydride), TCI America™
Supplier: TCI America P19841G
Specifications
| 10-Phenyl-9-anthraceneboronic Acid (contains varying amounts of Anhydride) | |
| Yellow | |
| MFCD11111989 | |
| 10-phenylanthracen-9-yl boronic acid, 10-phenyl-9-anthracene boronic acid, 10-phenyl-9-anthraceneboronic acid, 10-phenylanthracene-9-boronic acid, 10-phenylantrhacen-9-yl boronic acid, boronic acid, 10-phenyl-9-anthracenyl, pubchem19639, 9-borono-10-phenylanthracene, 10-phenylanthracene-9-ylboronic acid, 10-phenyl-9-anthryl boronic acid | |
| OB(O)C1=C2C=CC=CC2=C(C2=CC=CC=C2)C2=CC=CC=C12 | |
| 298.15 | |
| 298.15 |
| 334658-75-2 | |
| C20H15BO2 | |
| 1 g | |
| RVPCPPWNSMAZKR-UHFFFAOYSA-N | |
| (10-phenylanthracen-9-yl)boronic acid | |
| 22247164 | |
| Crystalline Powder |
Chemical Identifiers
| 334658-75-2 | |
| 298.15 | |
| RVPCPPWNSMAZKR-UHFFFAOYSA-N | |
| 22247164 | |
| OB(O)C1=C2C=CC=CC2=C(C2=CC=CC=C2)C2=CC=CC=C12 |
| C20H15BO2 | |
| MFCD11111989 | |
| 10-phenylanthracen-9-yl boronic acid, 10-phenyl-9-anthracene boronic acid, 10-phenyl-9-anthraceneboronic acid, 10-phenylanthracene-9-boronic acid, 10-phenylantrhacen-9-yl boronic acid, boronic acid, 10-phenyl-9-anthracenyl, pubchem19639, 9-borono-10-phenylanthracene, 10-phenylanthracene-9-ylboronic acid, 10-phenyl-9-anthryl boronic acid | |
| (10-phenylanthracen-9-yl)boronic acid |
Safety and Handling
TSCA : No