missing translation for 'onlineSavingsMsg'
Learn More
Learn More
10-(2-Naphthyl)anthracene-9-boronic Acid (contains varying amounts of Anhydride) 98.0+%, TCI America™
Supplier: TCI America N09291G
Specifications
| 10-(2-Naphthyl)anthracene-9-boronic Acid (contains varying amounts of Anhydride) | |
| Yellow | |
| MFCD11973625 | |
| 10-2-naphthyl anthracene-9-boronic acid, 10-naphthalen-2-yl anthracen-9-yl boronic acid, boronic acid, 10-2-naphthalenyl-9-anthracenyl, 10-naphthalen-2-yl anthracen-9-ylboronic acid, 10-2-naphthyl-9-anthrylboronic acid, 10-2-naphthyl-9-anthryl boronic acid, 10-naphth-2-ylanthracen-9-ylboronic acid, 10-naphthalen-2-yl-anthracene-9-boronic acid, 10-naphthalene-2-yl-anthracene-9-boronic acid | |
| B(C1=C2C=CC=CC2=C(C3=CC=CC=C13)C4=CC5=CC=CC=C5C=C4)(O)O | |
| 348.208 | |
| 348.21 | |
| Crystalline Powder |
| 597554-03-5 | |
| C24H17BO2 | |
| 1 g | |
| YGVDBZMVEURVOW-UHFFFAOYSA-N | |
| (10-naphthalen-2-ylanthracen-9-yl)boronic acid | |
| 23088556 | |
| ≥98.0% (HPLC) |
Chemical Identifiers
| 597554-03-5 | |
| 348.208 | |
| YGVDBZMVEURVOW-UHFFFAOYSA-N | |
| 23088556 | |
| B(C1=C2C=CC=CC2=C(C3=CC=CC=C13)C4=CC5=CC=CC=C5C=C4)(O)O |
| C24H17BO2 | |
| MFCD11973625 | |
| 10-2-naphthyl anthracene-9-boronic acid, 10-naphthalen-2-yl anthracen-9-yl boronic acid, boronic acid, 10-2-naphthalenyl-9-anthracenyl, 10-naphthalen-2-yl anthracen-9-ylboronic acid, 10-2-naphthyl-9-anthrylboronic acid, 10-2-naphthyl-9-anthryl boronic acid, 10-naphth-2-ylanthracen-9-ylboronic acid, 10-naphthalen-2-yl-anthracene-9-boronic acid, 10-naphthalene-2-yl-anthracene-9-boronic acid | |
| (10-naphthalen-2-ylanthracen-9-yl)boronic acid |
Safety and Handling
TSCA : No