missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1 Octane Sulfonic Acid Sodium Salt, HPLC Ion Pair Agent, Fisher Chemical™
Improve HPLC separation of basic analytes by ion pairing.
Supplier: Thermo Fisher Scientific O0028100
Description
- High purity
- Application tested
- Dissolves easily
Specifications
| 5324-84-5 | |
| 1.5% Max. | |
| C8H17NaO3S | |
| 100 g | |
| [Na+].CCCCCCCCS([O-])(=O)=O | |
| 216.27 | |
| HPLC |
| ≤ 1.00 AU at 210 nm, ≤ 0.1 AU at 220 nm, ≤ 0.04 AU at 254 nm, ≤ 0.04 AU at 280nm | |
| Conforms | |
| MFCD00007544 | |
| HRQDCDQDOPSGBR-UHFFFAOYSA-M | |
| sodium octane-1-sulfonate | |
| 216.7 | |
| Powder |
Chemical Identifiers
| 5324-84-5 | |
| 216.27 | |
| HRQDCDQDOPSGBR-UHFFFAOYSA-M | |
| [Na+].CCCCCCCCS([O-])(=O)=O |
| C8H17NaO3S | |
| MFCD00007544 | |
| sodium octane-1-sulfonate |
Safety and Handling
Recommended Storage : Ambient