Learn More
1-Naphthylacetic acid, 95%
CAS: 86-87-3 | C12H10O2 | 186.21 g/mol
Supplier: Thermo Scientific Chemicals 349641000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 1-Naphthylacetic acid | |
| 94.0 | |
| 126.0°C to 133.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00004046 | |
| 09, 666 | |
| 1-naphthylacetic acid, 1-naphthaleneacetic acid, 2-naphthalen-1-yl acetic acid, naphthalene-1-acetic acid, transplantone, phyomone, planofix, 1-naphthalene acetic acid, fruitone n, stop-drop | |
| PRPINYUDVPFIRX-UHFFFAOYSA-N | |
| 2-naphthalen-1-ylacetic acid | |
| 6862 | |
| 186.21 | |
| Powder |
| 86-87-3 | |
| 100.0 | |
| Beige or White to Yellow | |
| 94% min. (GC) | |
| C12H10O2 | |
| 100 g | |
| 15, 6456 | |
| Solubility in water: 0.38g/L (17°C). Other solubilities: soluble in aceton | |
| OC(=O)CC1=C2C=CC=CC2=CC=C1 | |
| 186.21 | |
| CHEBI:32918 | |
| 95% |
Chemical Identifiers
| 86-87-3 | |
| 186.21 | |
| PRPINYUDVPFIRX-UHFFFAOYSA-N | |
| 6862 | |
| 2-naphthalen-1-ylacetic acid |
| C12H10O2 | |
| MFCD00004046 | |
| 1-naphthylacetic acid, 1-naphthaleneacetic acid, 2-naphthalen-1-yl acetic acid, naphthalene-1-acetic acid, transplantone, phyomone, planofix, 1-naphthalene acetic acid, fruitone n, stop-drop | |
| CHEBI:32918 | |
| OC(=O)CC1=C2C=CC=CC2=CC=C1 |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
GHS Signal Word: Warning
EINECSNumber : 201-705-8
RUO – Research Use Only