Learn More
1-Naphthyl isothiocyanate, 98%
CAS: 551-06-4 | C11H7NS | 185.25 g/mol
$169.28 - $269.50
Chemical Identifiers
| CAS | 551-06-4 |
|---|---|
| Molecular Formula | C11H7NS |
| Molecular Weight (g/mol) | 185.25 |
| MDL Number | MFCD00003882 |
| InChI Key | JBDOSUUXMYMWQH-UHFFFAOYSA-N |
| Synonym | 1-naphthyl isothiocyanate, 1-naphthylisothiocyanate, anit, kesscocide, alpha-naphthyl isothiocyanate, naphthalene, 1-isothiocyanato, naphthalene, isothiocyanato, isothiocyanic acid, 1-naphthyl ester, 1-naftylisothiokyanat, isothiocyanic acid 1-naphthyl ester |
| PubChem CID | 11080 |
| ChEBI | CHEBI:35455 |
| IUPAC Name | 1-isothiocyanatonaphthalene |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N=C=S |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC128240050
|
Thermo Scientific Chemicals
128240050 |
5 g | Glass bottle |
N/A
|
|
||||
|
AC128240100
|
Thermo Scientific Chemicals
128240100 |
10 g | Glass bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 551-06-4 | |
| 185.25 | |
| JBDOSUUXMYMWQH-UHFFFAOYSA-N | |
| 11080 | |
| 1-isothiocyanatonaphthalene |
| C11H7NS | |
| MFCD00003882 | |
| 1-naphthyl isothiocyanate, 1-naphthylisothiocyanate, anit, kesscocide, alpha-naphthyl isothiocyanate, naphthalene, 1-isothiocyanato, naphthalene, isothiocyanato, isothiocyanic acid, 1-naphthyl ester, 1-naftylisothiokyanat, isothiocyanic acid 1-naphthyl ester | |
| CHEBI:35455 | |
| C1=CC=C2C(=C1)C=CC=C2N=C=S |
Specifications
| 551-06-4 | |
| 100.0 | |
| Yellow | |
| 98% | |
| C11H7NS | |
| MFCD00003882 | |
| 12, 1244 | |
| 15, 6493 | |
| Solubility in water: insoluble. Other solubilities: freely soluble in ether, benzene, hot alcohol,, acetone and ccl4 | |
| C1=CC=C2C(=C1)C=CC=C2N=C=S | |
| 185.25 | |
| CHEBI:35455 | |
| 98% | |
| 1-Naphthyl isothiocyanate, 98% |
| 97.5 | |
| 55.5°C to 57.0°C | |
| Authentic | |
| Glass bottle | |
| C10H7NCS | |
| 5 g | |
| 01,718 | |
| 1-naphthyl isothiocyanate, 1-naphthylisothiocyanate, anit, kesscocide, alpha-naphthyl isothiocyanate, naphthalene, 1-isothiocyanato, naphthalene, isothiocyanato, isothiocyanic acid, 1-naphthyl ester, 1-naftylisothiokyanat, isothiocyanic acid 1-naphthyl ester | |
| JBDOSUUXMYMWQH-UHFFFAOYSA-N | |
| 1-isothiocyanatonaphthalene | |
| 11080 | |
| 185.25 | |
| Fine Crystalline Powder |
Safety and Handling
GHS H Statement
Harmful in contact with skin.
Toxic if swallowed.
Harmful if inhaled.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
May cause allergy or asthma symptoms
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTRE or doctor/physician.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Gently wash with plenty of soap and water.
IF INHALED: Remove
GHS Signal Word: Danger
EINECSNumber : 208-990-8
RTECSNumber : NX9100000
TSCA : TSCA
RUO – Research Use Only