missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-Naphthyl acetate, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 227250250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 1-Naphthyl acetate | |
| 830-81-9 | |
| 100.0 | |
| 98.5% min. (HPLC) | |
| C12H10O2 | |
| MFCD00003922 | |
| 06, 608 | |
| VGKONPUVOVVNSU-UHFFFAOYSA-N | |
| naphthalen-1-yl acetate | |
| 13247 | |
| 99% |
| 99+% | |
| 99.0 | |
| Authentic | |
| Glass bottle | |
| CH3CO2C10H7 | |
| 25g | |
| 1-naphthyl acetate, 1-acetoxynaphthalene, alpha-naphthyl acetate, 1-naphthol, acetate, a-naphthyl acetate, naphthyl acetate, naphthalene, 1-acetoxy, 1-naphthalenol, acetate, acetic acid 1-naphthyl ester, alpha-naphthol acetate | |
| CC(=O)OC1=CC=CC2=CC=CC=C21 | |
| 186.21 | |
| 186.21 |
Chemical Identifiers
| 830-81-9 | |
| 186.21 | |
| VGKONPUVOVVNSU-UHFFFAOYSA-N | |
| 13247 | |
| CC(=O)OC1=CC=CC2=CC=CC=C21 |
| C12H10O2 | |
| MFCD00003922 | |
| 1-naphthyl acetate, 1-acetoxynaphthalene, alpha-naphthyl acetate, 1-naphthol, acetate, a-naphthyl acetate, naphthyl acetate, naphthalene, 1-acetoxy, 1-naphthalenol, acetate, acetic acid 1-naphthyl ester, alpha-naphthol acetate | |
| naphthalen-1-yl acetate |
Safety and Handling
EINECSNumber : 212-599-8
RTECSNumber : QL2975500
TSCA : TSCA
RUO â Research Use Only