Learn More
1-Naphthoyl chloride, 99%
CAS: 879-18-5 | C11H7ClO | 190.63 g/mol
Supplier: Thermo Scientific Chemicals 270380500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 1-Naphthoyl chloride | |
| 98.5 | |
| 16°C to 19°C | |
| 1.2600g/mL | |
| >110°C | |
| 98.5% min. (GC) | |
| C11H7ClO | |
| MFCD00004002 | |
| 09, 648 | |
| 1-naphthoyl chloride, 1-naphthalenecarbonyl chloride, 1-naphthoylchloride, 1-naphthoic acid chloride, 1-chlorocarbonyl naphthalene, alpha-naphthoyl chloride, .alpha.-naphthoyl chloride, naphthalenecarbonyl chloride, naphthoylchloride, naphthoyl chloride | |
| NSNPSJGHTQIXDO-UHFFFAOYSA-N | |
| naphthalene-1-carbonyl chloride | |
| 70146 | |
| 99% |
| 879-18-5 | |
| 100.0 | |
| White | |
| 190°C (35.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.6515 to 1.6535 | |
| 50 g | |
| 1.26 | |
| Solubility in water: decomposes | |
| ClC(=O)C1=C2C=CC=CC2=CC=C1 | |
| 190.63 | |
| 190.63 | |
| Crystals, Powder or Flakes |
Chemical Identifiers
| 879-18-5 | |
| 190.63 | |
| NSNPSJGHTQIXDO-UHFFFAOYSA-N | |
| 70146 | |
| ClC(=O)C1=C2C=CC=CC2=CC=C1 |
| C11H7ClO | |
| MFCD00004002 | |
| 1-naphthoyl chloride, 1-naphthalenecarbonyl chloride, 1-naphthoylchloride, 1-naphthoic acid chloride, 1-chlorocarbonyl naphthalene, alpha-naphthoyl chloride, .alpha.-naphthoyl chloride, naphthalenecarbonyl chloride, naphthoylchloride, naphthoyl chloride | |
| naphthalene-1-carbonyl chloride |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsi
GHS Signal Word: Danger
EINECSNumber : 212-903-9
RUO – Research Use Only