Learn More
1-(N-BOC-aminomethyl)-4-(aminomethyl)benzene, 90%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 426900050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 1-(N-BOC-aminomethyl)-4-(aminomethyl)benzene | |
| 94.0 | |
| Authentic | |
| Glass bottle | |
| NH2CH2C6H4CH2NHCO2C(CH3)3 | |
| 5g | |
| NUANLVJLUYWSER-UHFFFAOYSA-N | |
| tert-butyl N-[[4-(aminomethyl)phenyl]methyl]carbamate | |
| 3354775 | |
| 90% |
| 108468-00-4 | |
| 100.0 | |
| 89% min. (GC) | |
| C13H20N2O2 | |
| MFCD02683058 | |
| 1-n-boc-aminomethyl-4-aminomethyl benzene, tert-butyl 4-aminomethyl benzylcarbamate, tert-butyl n-4-aminomethyl benzyl carbamate, 4-aminomethyl-benzyl-carbamic acid tert-butyl ester, tert-butyl n-4-aminomethyl phenyl methyl carbamate, n-4-aminomethyl phenyl methyl tert-butoxy carboxamide, n-boc-p-xylylenediamine, 4-tert-butoxycarbonylaminomethyl benzylamine | |
| CC(C)(C)OC(=O)NCC1=CC=C(C=C1)CN | |
| 236.31 | |
| 236.31 |
Chemical Identifiers
| 108468-00-4 | |
| 236.31 | |
| NUANLVJLUYWSER-UHFFFAOYSA-N | |
| 3354775 | |
| CC(C)(C)OC(=O)NCC1=CC=C(C=C1)CN |
| C13H20N2O2 | |
| MFCD02683058 | |
| 1-n-boc-aminomethyl-4-aminomethyl benzene, tert-butyl 4-aminomethyl benzylcarbamate, tert-butyl n-4-aminomethyl benzyl carbamate, 4-aminomethyl-benzyl-carbamic acid tert-butyl ester, tert-butyl n-4-aminomethyl phenyl methyl carbamate, n-4-aminomethyl phenyl methyl tert-butoxy carboxamide, n-boc-p-xylylenediamine, 4-tert-butoxycarbonylaminomethyl benzylamine | |
| tert-butyl N-[[4-(aminomethyl)phenyl]methyl]carbamate |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
Harmful if swallowed.
Harmful in contact with skin.
Harmful if inhaled.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear eye protection/face protection.
IF IN EYES: Rinse cautiously with water for severa
GHS Signal Word: Danger
RUO â Research Use Only