missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-Hexanesulfonic Acid Sodium Salt (HPLC), Fisher Chemical™
Improve HPLC separation of basic analytes by ion pairing.
$564.50 - $1422.17
Chemical Identifiers
| CAS | 2832-45-3 |
|---|---|
| Molecular Formula | C6H13NaO3S |
| Molecular Weight (g/mol) | 188.22 |
| MDL Number | MFCD00007542 |
| InChI Key | QWSZRRAAFHGKCH-UHFFFAOYSA-M |
| Synonym | sodium 1-hexanesulfonate, sodium hexane-1-sulfonate, sodium hexanesulfonate, 1-hexanesulfonic acid sodium salt, 1-hexanesulfonic acid, sodium salt, 1-hexanesulfonic acid, sodium salt 1:1, 1-hexane sulfonic acid sodium salt, hexyl sodium sulfonate, 1-hexanesulfonate, sodium, hexanesulfonic acid na-salt |
| PubChem CID | 23677630 |
| IUPAC Name | sodium hexane-1-sulfonate |
| SMILES | [Na+].CCCCCCS([O-])(=O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
O3072-25
|
Thermo Fisher Scientific
O307225 |
25 g | Glass Bottle |
Each for $564.50
Case of 6 Each for $3,387.00
|
|
||||
|
O3072100
|
Thermo Fisher Scientific
O3072100 |
100 g |
Each for $1,422.17
Case of 6 Each for $8,533.02
|
|
|||||
Description
- High purity
- Application tested
- Dissolves easily
Chemical Identifiers
| 2832-45-3 | |
| 188.22 | |
| QWSZRRAAFHGKCH-UHFFFAOYSA-M | |
| 23677630 | |
| [Na+].CCCCCCS([O-])(=O)=O |
| C6H13NaO3S | |
| MFCD00007542 | |
| sodium 1-hexanesulfonate, sodium hexane-1-sulfonate, sodium hexanesulfonate, 1-hexanesulfonic acid sodium salt, 1-hexanesulfonic acid, sodium salt, 1-hexanesulfonic acid, sodium salt 1:1, 1-hexane sulfonic acid sodium salt, hexyl sodium sulfonate, 1-hexanesulfonate, sodium, hexanesulfonic acid na-salt | |
| sodium hexane-1-sulfonate |
Specifications
| Hexanesulfonic Acid Sodium Salt | |
| Pass Test | |
| White | |
| Glass Bottle | |
| CH3(CH2)5SO3Na | |
| 25 g | |
| Soluble in water | |
| [Na+].CCCCCCS([O-])(=O)=O | |
| 188.22 | |
| 188.22 | |
| HPLC | |
| 1-Hexanesulfonic Acid Sodium Salt |
| 2832-45-3 | |
| 300°C | |
| ≥98 % | |
| C6H13NaO3S | |
| MFCD00007542 | |
| sodium 1-hexanesulfonate, sodium hexane-1-sulfonate, sodium hexanesulfonate, 1-hexanesulfonic acid sodium salt, 1-hexanesulfonic acid, sodium salt, 1-hexanesulfonic acid, sodium salt 1:1, 1-hexane sulfonic acid sodium salt, hexyl sodium sulfonate, 1-hexanesulfonate, sodium, hexanesulfonic acid na-salt | |
| QWSZRRAAFHGKCH-UHFFFAOYSA-M | |
| sodium hexane-1-sulfonate | |
| 23677630 | |
| ≥98% | |
| Powder or Solid |
Safety and Handling
WARNING!
Emergency Overview
Irritating to eyes, respiratory system and skin. Ensure adequate ventilation. Do not get in eyes, on skin, or on clothing. Avoid ingestion and inhalation. Use personal protective equipment. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Obtain medical attention. Obtain medical attention. Do not induce vomiting.
NFPA
Health:2
Flammability:1
Instability:0