Learn More
1-Hexanesulfonic acid, sodium salt, 99+%, Ion pair chromatography, anhydrous
CAS: 2832-45-3 | C6H13NaO3S | 188.22 g/mol
Supplier: Thermo Scientific Chemicals 396671000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
For ion pair chromatographySpecifications
| 1-Hexanesulfonic acid, sodium salt | |
| 2832-45-3 | |
| 0.02 max. (C=0.5 M in water) at 260nm, 0.04 max. (C=0.5 M in water) at 230nm, 0.06 max. (C=0.5 M in water) at 220nm, 0.1 max. (C=0.5 M in water) at 210nm | |
| >300°C | |
| 2% max. (150°C) | |
| 99+% | |
| C6H13NaO3S | |
| MFCD00007542 | |
| sodium 1-hexanesulfonate, sodium hexane-1-sulfonate, sodium hexanesulfonate, 1-hexanesulfonic acid sodium salt, 1-hexanesulfonic acid, sodium salt, 1-hexanesulfonic acid, sodium salt 1:1, 1-hexane sulfonic acid sodium salt, hexyl sodium sulfonate, 1-hexanesulfonate, sodium, hexanesulfonic acid na-salt | |
| QWSZRRAAFHGKCH-UHFFFAOYSA-M | |
| sodium;hexane-1-sulfonate | |
| 23677630 | |
| 99+% | |
| Crystalline Solid |
| Anhydrous | |
| 99.0 | |
| 100.0 | |
| White | |
| Authentic | |
| Glass bottle | |
| CH3(CH2)5SO3Na | |
| 100 g | |
| Solubility in water: 300g/l | |
| [Na+].CCCCCCS([O-])(=O)=O | |
| 188.22 | |
| 188.22 | |
| Ion Pair Chromatography |
Chemical Identifiers
| 2832-45-3 | |
| 188.22 | |
| QWSZRRAAFHGKCH-UHFFFAOYSA-M | |
| 23677630 | |
| [Na+].CCCCCCS([O-])(=O)=O |
| C6H13NaO3S | |
| MFCD00007542 | |
| sodium 1-hexanesulfonate, sodium hexane-1-sulfonate, sodium hexanesulfonate, 1-hexanesulfonic acid sodium salt, 1-hexanesulfonic acid, sodium salt, 1-hexanesulfonic acid, sodium salt 1:1, 1-hexane sulfonic acid sodium salt, hexyl sodium sulfonate, 1-hexanesulfonate, sodium, hexanesulfonic acid na-salt | |
| sodium;hexane-1-sulfonate |
Safety and Handling
GHS H Statement
May cause respiratory irritation.
Causes skin irritation.
Causes serious eye irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning
EINECSNumber : 220-601-3
RUO – Research Use Only