missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-Heptanesulfonic Acid Sodium Salt (HPLC), Fisher Chemical™
Improve HPLC separation of basic analytes by ion pairing.
Supplier: Thermo Fisher Scientific O3013100
Description
- High purity
- Application tested
- Dissolves easily
Specifications
| Heptanesulfonic Acid Sodium Salt | |
| 22767-50-6 | |
| White | |
| C7H15NaO3S | |
| MFCD00007543 | |
| sodium 1-heptanesulfonate, sodium heptane-1-sulfonate, 1-heptanesulfonic acid sodium salt, 1-heptanesulfonic acid, sodium salt | |
| [Na+].CCCCCCCS([O-])(=O)=O | |
| 202.24 | |
| 202.24 | |
| HPLC |
| 1-Heptanesulfonic Acid Sodium Salt | |
| 300°C | |
| ≥98 % | |
| CH3(CH2)6SO3Na | |
| 100 g | |
| REFMEZARFCPESH-UHFFFAOYSA-M | |
| sodium heptane-1-sulfonate | |
| 23672332 | |
| ≥98% | |
| Powder or Solid |
Chemical Identifiers
| 22767-50-6 | |
| MFCD00007543 | |
| 23672332 |
| C7H15NaO3S | |
| REFMEZARFCPESH-UHFFFAOYSA-M |
Safety and Handling