Learn More
1-Chloro-2-nitrobenzene, 99+%
CAS: 88-73-3 | C6H4ClNO2 | 157.55 g/mol
$37.57 - $37.57
Chemical Identifiers
| CAS | 88-73-3 |
|---|---|
| Molecular Formula | C6H4ClNO2 |
| Molecular Weight (g/mol) | 157.55 |
| MDL Number | MFCD00007061 |
| InChI Key | BFCFYVKQTRLZHA-UHFFFAOYSA-N |
| Synonym | 2-chloronitrobenzene, o-chloronitrobenzene, 2-nitrochlorobenzene, chloronitrobenzene, o-nitrochlorobenzene, benzene, 1-chloro-2-nitro, 2-chloro-1-nitrobenzene, oncb, benzene, chloronitro, nitrochlorobenzene |
| PubChem CID | 6945 |
| ChEBI | CHEBI:34270 |
| IUPAC Name | 1-chloro-2-nitrobenzene |
| SMILES | [O-][N+](=O)C1=CC=CC=C1Cl |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC109621000
|
Thermo Scientific Chemicals
109621000 |
100 mL |
Each for $37.57
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 88-73-3 | |
| 157.55 | |
| BFCFYVKQTRLZHA-UHFFFAOYSA-N | |
| 6945 | |
| 1-chloro-2-nitrobenzene |
| C6H4ClNO2 | |
| MFCD00007061 | |
| 2-chloronitrobenzene, o-chloronitrobenzene, 2-nitrochlorobenzene, chloronitrobenzene, o-nitrochlorobenzene, benzene, 1-chloro-2-nitro, 2-chloro-1-nitrobenzene, oncb, benzene, chloronitro, nitrochlorobenzene | |
| CHEBI:34270 | |
| [O-][N+](=O)C1=CC=CC=C1Cl |
Specifications
| 88-73-3 | |
| 100.0 | |
| Yellow | |
| 246°C | |
| Authentic | |
| Glass bottle | |
| ClC6H4NO2 | |
| 100 mL | |
| 1.348 | |
| 2-chloronitrobenzene, o-chloronitrobenzene, 2-nitrochlorobenzene, chloronitrobenzene, o-nitrochlorobenzene, benzene, 1-chloro-2-nitro, 2-chloro-1-nitrobenzene, oncb, benzene, chloronitro, nitrochlorobenzene | |
| BFCFYVKQTRLZHA-UHFFFAOYSA-N | |
| 1-chloro-2-nitrobenzene | |
| 6945 | |
| 157.56 | |
| Fused Crystalline Mass |
| 99.0 | |
| 32°C to 34°C | |
| 1.3480g/mL | |
| 124°C | |
| 99+% | |
| C6H4ClNO2 | |
| MFCD00007061 | |
| 05, 241 | |
| 15, 2153 | |
| Solubility in water: 0.43g/L water (20°C).,soluble in alcohol,benzene,ether,acetone,carbo,toluene,pyridine | |
| [O-][N+](=O)C1=CC=CC=C1Cl | |
| 157.55 | |
| CHEBI:34270 | |
| 99+% | |
| 1-Chloro-2-nitrobenzene, 99+% |
Safety and Handling
GHS H Statement:
Harmful to aquatic life with long lasting effects.
Toxic in contact with skin.
Harmful if swallowed.
GHS P Statement:
Wear protective gloves/protective clothing/eye protection/face protection.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Gently wash with plenty of soap and water.
Avoid release to the environment.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
GHS Signal Word: Danger
EINECSNumber : 201-854-9
RTECSNumber : CZ0875000
TSCA : TSCA
RUO – Research Use Only