Learn More
1-Chloro-2,4-dinitrobenzene, 99%
CAS: 97-00-7 | C6H3ClN2O4 | 202.55 g/mol
$67.54 - $226.24
Chemical Identifiers
| CAS | 97-00-7 |
|---|---|
| Molecular Formula | C6H3ClN2O4 |
| Molecular Weight (g/mol) | 202.55 |
| MDL Number | MFCD00007075 |
| InChI Key | VYZAHLCBVHPDDF-UHFFFAOYSA-N |
| Synonym | 2,4-dinitrochlorobenzene, dinitrochlorobenzene, dncb, cdnb, chlorodinitrobenzene, 4-chloro-1,3-dinitrobenzene, 2,4-dinitrophenyl chloride, benzene, 1-chloro-2,4-dinitro, dinitrochlorobenzol, 1,3-dinitro-4-chlorobenzene |
| PubChem CID | 6 |
| ChEBI | CHEBI:34718 |
| IUPAC Name | 1-chloro-2,4-dinitrobenzene |
| SMILES | [O-][N+](=O)C1=CC=C(Cl)C(=C1)[N+]([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC160511000
|
Thermo Scientific Chemicals
160511000 |
100 g | Plastic bottle |
N/A
|
|
||||
|
AC160515000
|
Thermo Scientific Chemicals
160515000 |
500 g | Plastic bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 97-00-7 | |
| 202.55 | |
| VYZAHLCBVHPDDF-UHFFFAOYSA-N | |
| 6 | |
| 1-chloro-2,4-dinitrobenzene |
| C6H3ClN2O4 | |
| MFCD00007075 | |
| 2,4-dinitrochlorobenzene, dinitrochlorobenzene, dncb, cdnb, chlorodinitrobenzene, 4-chloro-1,3-dinitrobenzene, 2,4-dinitrophenyl chloride, benzene, 1-chloro-2,4-dinitro, dinitrochlorobenzol, 1,3-dinitro-4-chlorobenzene | |
| CHEBI:34718 | |
| [O-][N+](=O)C1=CC=C(Cl)C(=C1)[N+]([O-])=O |
Specifications
| 97-00-7 | |
| 100.0 | |
| Yellow to Brown | |
| 186°C | |
| 98.5% min. (GC) | |
| C6H3ClN2O4 | |
| MFCD00007075 | |
| 05, 263 | |
| 2,4-dinitrochlorobenzene, dinitrochlorobenzene, dncb, cdnb, chlorodinitrobenzene, 4-chloro-1,3-dinitrobenzene, 2,4-dinitrophenyl chloride, benzene, 1-chloro-2,4-dinitro, dinitrochlorobenzol, 1,3-dinitro-4-chlorobenzene | |
| VYZAHLCBVHPDDF-UHFFFAOYSA-N | |
| 1-chloro-2,4-dinitrobenzene | |
| 6 | |
| 202.55 | |
| Crystalline Mass, Chunks or Crystals and Powder |
| 98.5 | |
| 48°C to 53°C | |
| 315°C | |
| Authentic | |
| Plastic bottle | |
| ClC6H3(NO2)2 | |
| 100 g | |
| 15, 2137 | |
| Solubility in water: insoluble. Other solubilities: soluble in hot alcohol,ether,benzene and,carbon disulfide | |
| [O-][N+](=O)C1=CC=C(Cl)C(=C1)[N+]([O-])=O | |
| 202.55 | |
| CHEBI:34718 | |
| 99% | |
| 1-Chloro-2, 4-dinitrobenzene, 99% |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Fatal in contact with skin.
Causes skin irritation.
May cause an allergic skin reaction.
Causes serious eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Immediately call a POISON CENTER or doctor/physician.
IF ON SKIN: Wash with plenty of soap and water.
If skin irritation occurs: Get medical advice/attention.
GHS Signal Word: Danger
EINECSNumber : 202-551-4
RTECSNumber : CZ0525000
TSCA : TSCA
RUO – Research Use Only