missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-Benzothiophene-3-carboxylic acid, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals CC12301DE
| Quantity | 5g |
|---|---|
| Packaging | Amber Glass Bottle |
Chemical Identifiers
| C9H6O2S | |
| MFCD01846406 | |
| benzo b thiophene-3-carboxylic acid, benzothiophene-3-carboxylic acid, benzothiophene-3-carboxylicacid, pubchem13463, acmc-20a10z, ksc178m8d, 1-benzo b thiophene-3-carboxylic acid, #, thianaphthene-3-carboxylic acid | |
| 1-benzothiophene-3-carboxylic acid |
Specifications
| 1-Benzothiophene-3-carboxylic acid | |
| 96.5 | |
| 97% | |
| C9H6O2S | |
| MFCD01846406 | |
| DRBLTQNCQJXSNU-UHFFFAOYSA-N | |
| 1-benzothiophene-3-carboxylic acid | |
| 601280 | |
| 97% |
| 5381-25-9 | |
| 100.0 | |
| Amber Glass Bottle | |
| 5g | |
| benzo b thiophene-3-carboxylic acid, benzothiophene-3-carboxylic acid, benzothiophene-3-carboxylicacid, pubchem13463, acmc-20a10z, ksc178m8d, 1-benzo b thiophene-3-carboxylic acid, #, thianaphthene-3-carboxylic acid | |
| C1=CC=C2C(=C1)C(=CS2)C(=O)O | |
| 178.205 | |
| 178.21 |
Safety and Handling
GHS P Statement Causes skin irritation. Causes serious eye irritation.
GHS P Statement Avoid breathing dust/fume/gas/mist/vapors/spray. IF ON SKIN: Wash with plenty of soap and water. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously
Warning