missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-Amino-2-Naphthol-4-Sulfonic Acid, Reagent Grade, LabChem™
Supplier: LabChem LC108508
Specifications
| 1-Amino-2-Naphthol-4-Sulfonic Acid | |
| 100 | |
| Pink | |
| C10H9NO4S | |
| 25 g | |
| Soluble in water | |
| C1=CC=C2C(=C1)C(=CC(=C2N)O)S(=O)(=O)O | |
| 239.245 | |
| CHEBI:19024 | |
| Reagent |
| 116-63-2 | |
| 295°C | |
| Poly Bottle | |
| H2N(HO)C10H5SO3H | |
| 1-amino-2-naphthol-4-sulfonic acid, 4-amino-3-hydroxy-1-naphthalenesulfonic acid, 1-amino-4-sulfo-2-naphthol, 1,2,4-acid, unii-w46sk3p33g, 1-naphthalenesulfonic acid, 4-amino-3-hydroxy, 4-amino-3-hydroxynaphthalene-1-sulphonic acid, 4-amino-3-hydroxynaphthalenesulfonic acid, 1,2,4-aminonaphtholsulfonic acid, 2-hydroxy-4-sulfo-1-naphthylamine | |
| RXCMFQDTWCCLBL-UHFFFAOYSA-N | |
| 4-amino-3-hydroxynaphthalene-1-sulfonic acid | |
| 8316 | |
| 239.26 | |
| Fluffy Solid |
Chemical Identifiers
| 116-63-2 | |
| 239.245 | |
| 1-amino-2-naphthol-4-sulfonic acid, 4-amino-3-hydroxy-1-naphthalenesulfonic acid, 1-amino-4-sulfo-2-naphthol, 1,2,4-acid, unii-w46sk3p33g, 1-naphthalenesulfonic acid, 4-amino-3-hydroxy, 4-amino-3-hydroxynaphthalene-1-sulphonic acid, 4-amino-3-hydroxynaphthalenesulfonic acid, 1,2,4-aminonaphtholsulfonic acid, 2-hydroxy-4-sulfo-1-naphthylamine | |
| CHEBI:19024 | |
| C1=CC=C2C(=C1)C(=CC(=C2N)O)S(=O)(=O)O |
| C10H9NO4S | |
| RXCMFQDTWCCLBL-UHFFFAOYSA-N | |
| 8316 | |
| 4-amino-3-hydroxynaphthalene-1-sulfonic acid |
Safety and Handling
GHS H Statement
Product is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Refrigerate