missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-Adamantyl methyl ketone, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 164740250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 1-Adamantyl methyl ketone | |
| 1660-04-4 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| MFCD00074739 | |
| 1-adamantyl methyl ketone, 1-acetyladamantane, 1-1-adamantyl ethanone, 1-adamantylmethylketone, 1-adamantan-1-yl ethan-1-one, 1-adamantan-1-yl ethanone, acetyladamantane, methyl 1-adamantyl ketone, 1-adamantan-1-yl-ethanone, adamantyl methyl ketone | |
| CC(=O)C12CC3CC(CC(C3)C1)C2 | |
| 178.28 | |
| 178.27 |
| 99% | |
| 98.5 | |
| 108°C | |
| 99% | |
| C12H18O | |
| 25g | |
| DACIGVIOAFXPHW-UHFFFAOYSA-N | |
| 1-(1-adamantyl)ethanone | |
| 123126 | |
| 99% |
Chemical Identifiers
| 1660-04-4 | |
| 178.28 | |
| DACIGVIOAFXPHW-UHFFFAOYSA-N | |
| 123126 | |
| CC(=O)C12CC3CC(CC(C3)C1)C2 |
| C12H18O | |
| MFCD00074739 | |
| 1-adamantyl methyl ketone, 1-acetyladamantane, 1-1-adamantyl ethanone, 1-adamantylmethylketone, 1-adamantan-1-yl ethan-1-one, 1-adamantan-1-yl ethanone, acetyladamantane, methyl 1-adamantyl ketone, 1-adamantan-1-yl-ethanone, adamantyl methyl ketone | |
| 1-(1-adamantyl)ethanone |
Safety and Handling
EINECSNumber : 216-761-9
TSCA : TSCA
RUO â Research Use Only