Learn More
1,8-Diaminonaphthalene, 97%
CAS: 479-27-6 | C10H10N2 | 158.2 g/mol
Supplier: Thermo Scientific Chemicals 371180050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 1, 8-Diaminonaphthalene | |
| 479-27-6 | |
| 100.0 | |
| Brown or Gray to Gray-Red | |
| 195°C | |
| 96% min. (GC) | |
| C10H10N2 | |
| MFCD00004033 | |
| 13, 205 | |
| 1,8-diaminonaphthalene, 1,8-naphthalenediamine, 1,8-naphthylenediamine, unii-ika7029yh9, ccris 8398, 1,8-diaminonapthalene, 1,8-diamino naphthalene, 1,8-naphthalene diamine, acmc-209kb1, ksc236e9t | |
| YFOOEYJGMMJJLS-UHFFFAOYSA-N | |
| naphthalene-1,8-diamine | |
| 68067 | |
| 97% |
| 97% | |
| 96.0 | |
| 63.0°C to 66.0°C | |
| 205.0°C (12.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| C10H6(NH2)2 | |
| 5 g | |
| 15, 6457 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in alcohol and ether, slightly soluble in chloroform | |
| C1=CC2=C(C(=C1)N)C(=CC=C2)N | |
| 158.2 | |
| 158.2 | |
| Crystalline Mass or Chunks |
Chemical Identifiers
| 479-27-6 | |
| 158.2 | |
| YFOOEYJGMMJJLS-UHFFFAOYSA-N | |
| 68067 | |
| C1=CC2=C(C(=C1)N)C(=CC=C2)N |
| C10H10N2 | |
| MFCD00004033 | |
| 1,8-diaminonaphthalene, 1,8-naphthalenediamine, 1,8-naphthylenediamine, unii-ika7029yh9, ccris 8398, 1,8-diaminonapthalene, 1,8-diamino naphthalene, 1,8-naphthalene diamine, acmc-209kb1, ksc236e9t | |
| naphthalene-1,8-diamine |
Safety and Handling
GHS H Statement
Harmful if swallowed.
May cause an allergic skin reaction.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
If s
GHS Signal Word: Warning
EINECSNumber : 207-529-8
RUO – Research Use Only