Learn More
1,3,5-Benzenetricarboxylic acid, 98%
1, 3, 5-Benzenetricarboxylic acid, 98%, C9H6O6, CAS Number-554-95-0, 1,3,5-benzene tricarboxylic acid, 1,3,5-benzenetricarboxylic acid, 1,3,5-tricarboxybenzene, 5-carboxyisophthalic acid, chembl77562, ou36oo5mtn, trimesic acid, trimesinic acid, trimesitinic acid, unii-ou36oo5mtn, 500g | CAS: 554-95-0 | C9H6O6 | 210.14 g/mol
$126.60 - $126.60
Chemical Identifiers
| CAS | 554-95-0 |
|---|---|
| Molecular Formula | C9H6O6 |
| Molecular Weight (g/mol) | 210.14 |
| MDL Number | MFCD00002517 |
| InChI Key | QMKYBPDZANOJGF-UHFFFAOYSA-N |
| Synonym | trimesic acid, 1,3,5-benzenetricarboxylic acid, trimesinic acid, trimesitinic acid, 5-carboxyisophthalic acid, 1,3,5-benzene tricarboxylic acid, 1,3,5-tricarboxybenzene, unii-ou36oo5mtn, ou36oo5mtn, chembl77562 |
| PubChem CID | 11138 |
| ChEBI | CHEBI:46032 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid |
| SMILES | OC(=O)C1=CC(=CC(=C1)C(O)=O)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC105350500
|
Thermo Scientific Chemicals
105350500 |
50 g | Plastic bottle |
Each for $126.60
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 554-95-0 | |
| 210.14 | |
| QMKYBPDZANOJGF-UHFFFAOYSA-N | |
| 11138 | |
| benzene-1,3,5-tricarboxylic acid |
| C9H6O6 | |
| MFCD00002517 | |
| trimesic acid, 1,3,5-benzenetricarboxylic acid, trimesinic acid, trimesitinic acid, 5-carboxyisophthalic acid, 1,3,5-benzene tricarboxylic acid, 1,3,5-tricarboxybenzene, unii-ou36oo5mtn, ou36oo5mtn, chembl77562 | |
| CHEBI:46032 | |
| OC(=O)C1=CC(=CC(=C1)C(O)=O)C(O)=O |
Specifications
| 554-95-0 | |
| 100.0 | |
| >250°C | |
| Plastic bottle | |
| C6H3(CO2H)3 | |
| 50 g | |
| trimesic acid, 1,3,5-benzenetricarboxylic acid, trimesinic acid, trimesitinic acid, 5-carboxyisophthalic acid, 1,3,5-benzene tricarboxylic acid, 1,3,5-tricarboxybenzene, unii-ou36oo5mtn, ou36oo5mtn, chembl77562 | |
| QMKYBPDZANOJGF-UHFFFAOYSA-N | |
| benzene-1,3,5-tricarboxylic acid | |
| 11138 | |
| 210.14 | |
| 1, 3, 5-Benzenetricarboxylic acid |
| 97.5 | |
| 380.0°C | |
| 97.5% min. (HPLC) | |
| C9H6O6 | |
| MFCD00002517 | |
| 09, 978 | |
| Solubility in water: 2.6g/L (25°C)- 7.9g/L (50°C). Other solubilities: 1.24g/100g ethyl ether- 8g/100g methanol,0.46g/100g acetic acid- >20.00g/100g thf (25°C),1.88g/100g acetone- <0.01g/100g xylene (25°C),<0.01g/1 | |
| OC(=O)C1=CC(=CC(=C1)C(O)=O)C(O)=O | |
| 210.14 | |
| CHEBI:46032 | |
| 98% |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
If eye irritation persists: Get medical advice/attention.
Wear protective gloves/protective clothing/eye protection/face protection.
IF INHALED: Remove to fresh air and
GHS Signal Word: Warning
EINECSNumber : 209-077-7
RUO – Research Use Only