missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
![1,3,4,6,7,8-Hexahydro-4,6,6,7,8,8-hexamethylcyclopenta[g]-2-benzopyran (ca. 50% in Diethyl Phthalate), TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-1222-05-5.jpg-650.jpg)
![1,3,4,6,7,8-Hexahydro-4,6,6,7,8,8-hexamethylcyclopenta[g]-2-benzopyran (ca. 50% in Diethyl Phthalate), TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/TCI-America/logos/Rings Blue.jpg-650.jpg)
1,3,4,6,7,8-Hexahydro-4,6,6,7,8,8-hexamethylcyclopenta[g]-2-benzopyran (ca. 50% in Diethyl Phthalate), TCI America™
Supplier: TCI America G041525G
Specifications
| 1,3,4,6,7,8-Hexahydro-4,6,6,7,8,8-hexamethylcyclopenta[g]-2-benzopyran (ca. 50% in Diethyl Phthalate | |
| Yellow | |
| C18H26O | |
| 25 g | |
| ONKNPOPIGWHAQC-UHFFFAOYSA-N | |
| 4,6,6,7,8,8-hexamethyl-1,3,4,7-tetrahydrocyclopenta[g]isochromene | |
| 91497 | |
| 258.41 |
| 1222-05-5 | |
| 304°C | |
| MFCD00217003 | |
| 3082 | |
| CC1COCC2=CC3=C(C=C12)C(C(C3(C)C)C)(C)C | |
| 258.405 | |
| CHEBI:83784 | |
| Liquid |
Chemical Identifiers
| 1222-05-5 | |
| 258.405 | |
| ONKNPOPIGWHAQC-UHFFFAOYSA-N | |
| CHEBI:83784 | |
| CC1COCC2=CC3=C(C=C12)C(C(C3(C)C)C)(C)C |
| C18H26O | |
| MFCD00217003 | |
| 91497 | |
| 4,6,6,7,8,8-hexamethyl-1,3,4,7-tetrahydrocyclopenta[g]isochromene |
Safety and Handling
EINECSNumber : (5)-0683
RTECSNumber : GY0790000
TSCA : Yes