missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1,2-Bis(chlorodimethylsilyl)ethane 95.0+%, TCI America™
Supplier: TCI America B16885G
Specifications
| 1,2-Bis(chlorodimethylsilyl)ethane [Protecting Reagent for Primary Amines] | |
| White | |
| C6H16Cl2Si2 | |
| 5 g | |
| 1,2-bis chlorodimethylsilyl ethane, ethylenebis chlorodimethylsilane, silane, 1,2-ethanediylbis chlorodimethyl, unii-b4ocj0e6j1, 1,1,4,4-tetramethyl-1,4-dichlorodisilethylene, chloro 2-chlorodimethylsilyl ethyl dimethylsilane, b4ocj0e6j1, 2,5-dichloro-2,5-dimethyl-2,5-disilahexane, 1,1,4,4-tetramethyl-1,4-dichloro-disylethylene | |
| C[Si](C)(Cl)CC[Si](C)(C)Cl | |
| 215.26 | |
| 215.26 | |
| Crystals |
| 13528-93-3 | |
| 198°C | |
| MFCD00000505 | |
| 2987 | |
| VGQOKOYKFDUPPJ-UHFFFAOYSA-N | |
| chloro[2-(chlorodimethylsilyl)ethyl]dimethylsilane | |
| 83552 | |
| ≥95.0% (GC) |
Chemical Identifiers
| 13528-93-3 | |
| 215.26 | |
| VGQOKOYKFDUPPJ-UHFFFAOYSA-N | |
| 83552 | |
| C[Si](C)(Cl)CC[Si](C)(C)Cl |
| C6H16Cl2Si2 | |
| MFCD00000505 | |
| 1,2-bis chlorodimethylsilyl ethane, ethylenebis chlorodimethylsilane, silane, 1,2-ethanediylbis chlorodimethyl, unii-b4ocj0e6j1, 1,1,4,4-tetramethyl-1,4-dichlorodisilethylene, chloro 2-chlorodimethylsilyl ethyl dimethylsilane, b4ocj0e6j1, 2,5-dichloro-2,5-dimethyl-2,5-disilahexane, 1,1,4,4-tetramethyl-1,4-dichloro-disylethylene | |
| chloro[2-(chlorodimethylsilyl)ethyl]dimethylsilane |
Safety and Handling
TSCA : Yes