Learn More
1,18-Octadecanedicarboxylic acid
CAS: 2424-92-2 | C20H38O4 | 342.52 g/mol
Supplier: Thermo Scientific Chemicals 04200409
Description
1,18-Octadecanedicarboxylic acid is used as an intermediate in organic synthesis, as dispersing agent, emulsifying agent, as lubricant.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 1,18-Octadecanedicarboxylic acid | |
| 127°C | |
| HO2C(CH2)18CO2H | |
| 10 g | |
| Slightly soluble in water. | |
| C(CCCCCCCCCC(=O)O)CCCCCCCCC(=O)O | |
| 342.52 | |
| CHEBI:73728 | |
| Powder |
| 2424-92-2 | |
| C20H38O4 | |
| MFCD00059627 | |
| eicosanedioic acid, unii-sod235tgnz, 1,18-octadecanedicarboxylic acid, sod235tgnz, octadecane-1,18-dicarboxylic acid, eicosanedioicacid, 1,20-icosanedioic acid, 1,20-eicosanedioic acid, eicosa-1,20-dioic acid | |
| JJOJFIHJIRWASH-UHFFFAOYSA-N | |
| icosanedioic acid | |
| 75502 | |
| 342.52 |
Chemical Identifiers
| 2424-92-2 | |
| 342.52 | |
| JJOJFIHJIRWASH-UHFFFAOYSA-N | |
| 75502 | |
| icosanedioic acid |
| C20H38O4 | |
| MFCD00059627 | |
| eicosanedioic acid, unii-sod235tgnz, 1,18-octadecanedicarboxylic acid, sod235tgnz, octadecane-1,18-dicarboxylic acid, eicosanedioicacid, 1,20-icosanedioic acid, 1,20-eicosanedioic acid, eicosa-1,20-dioic acid | |
| CHEBI:73728 | |
| C(CCCCCCCCCC(=O)O)CCCCCCCCC(=O)O |
Safety and Handling
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only