Learn More
1,11-Undecanedicarboxylic acid, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 369440050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 1, 11-Undecanedicarboxylic acid | |
| 505-52-2 | |
| 100.0 | |
| 94% | |
| C13H24O4 | |
| MFCD00002740 | |
| 02,731 | |
| Solubility in water: insoluble. Other solubilities: soluble in ethanol,ether | |
| C(CCCCCC(=O)O)CCCCCC(=O)O | |
| 244.33 | |
| CHEBI:73718 | |
| ≥92% |
| 94% | |
| 92.0 | |
| Authentic | |
| Glass bottle | |
| HO2C(CH2)11CO2H | |
| 5g | |
| brassylic acid, 1,11-undecanedicarboxylic acid, brassilic acid, 1,13-tridecanedioic acid, brassylate, unii-pl3iq40c34, undecane-1,11-dicarboxylic acid, tridecanedioate, dsstox_cid_1683, dsstox_rid_76281 | |
| DXNCZXXFRKPEPY-UHFFFAOYSA-N | |
| tridecanedioic acid | |
| 10458 | |
| 244.33 |
Chemical Identifiers
| 505-52-2 | |
| 244.33 | |
| DXNCZXXFRKPEPY-UHFFFAOYSA-N | |
| 10458 | |
| tridecanedioic acid |
| C13H24O4 | |
| MFCD00002740 | |
| brassylic acid, 1,11-undecanedicarboxylic acid, brassilic acid, 1,13-tridecanedioic acid, brassylate, unii-pl3iq40c34, undecane-1,11-dicarboxylic acid, tridecanedioate, dsstox_cid_1683, dsstox_rid_76281 | |
| CHEBI:73718 | |
| C(CCCCCC(=O)O)CCCCCC(=O)O |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Harmful to aquatic life with long lasting effects.
GHS P Statement
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Call a POISON CENTER or doctor/physician if you feel unwell.
Wear protective gloves/pro
GHS Signal Word: Warning
EINECSNumber : 208-011-4
RUO â Research Use Only