Learn More
1,10-Phenanthroline Monohydrochloride Monohydrate, 97%
CAS: 18851-33-7 | HCl·H2O | 234.69 g/mol
Supplier: Thermo Scientific Chemicals 130140250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 1, 10-Phenanthroline monohydrochloride monohydrate | |
| 96.0 | |
| 224.0°C to 225.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00150061 | |
| 1,10-phenanthroline hydrochloride monohydrate, 1,10-phenanthroline hydrochloride hydrate, 1,10-phenanthroline monohydrochloride monohydrate, 1,10-phenanthroline hydrate hydrochloride, 1,10-phenanthroline, monohydrochloride, monohydrate, phen hydrate hydrochloride, acmc-209iz9, dsstox_cid_24309, dsstox_rid_80145, dsstox_gsid_44309 | |
| NDLHUHRGAIHALB-UHFFFAOYSA-N | |
| 1,10-phenanthroline;hydrate;hydrochloride | |
| 2723715 | |
| 97% |
| 18851-33-7 | |
| 100.0 | |
| Purple or White to Yellow | |
| 97% | |
| HCl·H2O | |
| 25 g | |
| Solubility in water: freely soluble. | |
| C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.O.Cl | |
| 234.69 | |
| 234.69 | |
| Powder |
Chemical Identifiers
| 18851-33-7 | |
| 234.69 | |
| NDLHUHRGAIHALB-UHFFFAOYSA-N | |
| 2723715 | |
| C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.O.Cl |
| HCl·H2O | |
| MFCD00150061 | |
| 1,10-phenanthroline hydrochloride monohydrate, 1,10-phenanthroline hydrochloride hydrate, 1,10-phenanthroline monohydrochloride monohydrate, 1,10-phenanthroline hydrate hydrochloride, 1,10-phenanthroline, monohydrochloride, monohydrate, phen hydrate hydrochloride, acmc-209iz9, dsstox_cid_24309, dsstox_rid_80145, dsstox_gsid_44309 | |
| 1,10-phenanthroline;hydrate;hydrochloride |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wash face,hands and any exposed skin thoroughly after handling.
GHS Signal Word: Danger
RUO – Research Use Only