missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1,10-Phenanthroline monohydrate, 99+%, pure
CAS: 5144-89-8 | C12H10N2O | 198.23 g/mol
$101.57 - $4385.46
Chemical Identifiers
| CAS | 5144-89-8 |
|---|---|
| Molecular Formula | C12H10N2O |
| Molecular Weight (g/mol) | 198.23 |
| MDL Number | MFCD00149973 |
| InChI Key | PPQJCISYYXZCAE-UHFFFAOYSA-N |
| PubChem CID | 21226 |
| SMILES | O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC130130050
|
Thermo Scientific Chemicals
130150050 |
5 g | Glass bottle |
Each for $101.57
|
|
||||
|
AC130130250
|
Thermo Scientific Chemicals
130130250 |
25 g | Glass bottle |
Each for $337.74
|
|
||||
|
AC130131000
|
Thermo Scientific Chemicals
130131000 |
100 g | Glass bottle |
Each for $1,286.02
|
|
||||
|
AC130135000
|
Thermo Scientific Chemicals
130135000 |
500 g | Glass bottle |
Each for $4,385.46
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 5144-89-8 | |
| 198.23 | |
| PPQJCISYYXZCAE-UHFFFAOYSA-N | |
| O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 |
| C12H10N2O | |
| MFCD00149973 | |
| 21226 |
Specifications
| 5144-89-8,66-71-7 | |
| 100.0 | |
| Cream-White | |
| 99+% | |
| C12H10N2O | |
| 5 g | |
| 15,7328 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in alcohol, acetone and benzene | |
| O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 | |
| 198.23 | |
| 198.23 | |
| Pure | |
| 1, 10-Phenanthroline monohydrate |
| 99.0 | |
| 97.0°C to 101.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00149973 | |
| 23,227 | |
| 1,10-phenanthroline hydrate, 1,10-phenanthroline monohydrate, o-phenanthroline monohydrate, unii-ksx215x00e, 1,10-fenantrolina, 4,5-phenanthroline monohydrate, 1,10-phenanthroline, monohydrate, 1,10-fenanthrolin, 1,10-phenanthrolineo-phenanthroline, 1, 10-phenanthroline monohydrate | |
| PPQJCISYYXZCAE-UHFFFAOYSA-N | |
| 1,10-phenanthroline;hydrate | |
| 21226 | |
| 99+% | |
| Needle-like Crystalline Powder |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Avoid release to the environment.
GHS Signal Word: Danger
RUO – Research Use Only