missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-(1-Naphthyl)-2-(trimethylsilyl)acetylene, 97%
CAS: 104784-51-2 | C15H16Si | 224.378 g/mol
$69.56 - $771.44
Chemical Identifiers
| CAS | 104784-51-2 |
|---|---|
| Molecular Formula | C15H16Si |
| Molecular Weight (g/mol) | 224.378 |
| MDL Number | MFCD04039886 |
| InChI Key | WATBCTJRCLNXNF-UHFFFAOYSA-N |
| Synonym | 1-1-naphthyl-2-trimethylsilyl acetylene, trimethyl 2-naphthalen-1-ylethynyl silane, trimethyl 2-naphthalen-1-yl ethynyl silane, 1-naphthylethynyl trimethylsilane, 1-trimethylsilylethynyl naphthalene, 1-trimethylsilyl ethynyl naphthalene, trimethyl naphthalen-1-ylethynyl silane, trimethyl naphthalen-1-yl ethynyl silane, trimethylnaphthalen-1-ylethynylsilane |
| PubChem CID | 4438232 |
| IUPAC Name | trimethyl(2-naphthalen-1-ylethynyl)silane |
| SMILES | C[Si](C)(C)C#CC1=CC=CC2=CC=CC=C21 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAH5595303
|
Thermo Scientific Chemicals
H5595303 |
1 g |
Each for $69.56
|
|
|||||
|
AAH5595306
|
Thermo Scientific Chemicals
H5595306 |
5 g |
Each for $233.01
|
|
|||||
|
AAH5595314
|
Thermo Scientific Chemicals
H5595314 |
25 g |
Each for $771.44
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 104784-51-2 | |
| 224.378 | |
| WATBCTJRCLNXNF-UHFFFAOYSA-N | |
| 4438232 | |
| C[Si](C)(C)C#CC1=CC=CC2=CC=CC=C21 |
| C15H16Si | |
| MFCD04039886 | |
| 1-1-naphthyl-2-trimethylsilyl acetylene, trimethyl 2-naphthalen-1-ylethynyl silane, trimethyl 2-naphthalen-1-yl ethynyl silane, 1-naphthylethynyl trimethylsilane, 1-trimethylsilylethynyl naphthalene, 1-trimethylsilyl ethynyl naphthalene, trimethyl naphthalen-1-ylethynyl silane, trimethyl naphthalen-1-yl ethynyl silane, trimethylnaphthalen-1-ylethynylsilane | |
| trimethyl(2-naphthalen-1-ylethynyl)silane |
Specifications
| 104784-51-2 | |
| 0.968 g/mL | |
| >110°C (230°F) | |
| 1.595 | |
| 1 g | |
| WATBCTJRCLNXNF-UHFFFAOYSA-N | |
| trimethyl(2-naphthalen-1-ylethynyl)silane | |
| 4438232 | |
| 97% | |
| 1-(1-Naphthyl)-2-(trimethylsilyl)acetylene |
| 41°C to 43°C | |
| 292°C to 293°C | |
| C15H16Si | |
| MFCD04039886 | |
| 1-1-naphthyl-2-trimethylsilyl acetylene, trimethyl 2-naphthalen-1-ylethynyl silane, trimethyl 2-naphthalen-1-yl ethynyl silane, 1-naphthylethynyl trimethylsilane, 1-trimethylsilylethynyl naphthalene, 1-trimethylsilyl ethynyl naphthalene, trimethyl naphthalen-1-ylethynyl silane, trimethyl naphthalen-1-yl ethynyl silane, trimethylnaphthalen-1-ylethynylsilane | |
| C[Si](C)(C)C#CC1=CC=CC2=CC=CC=C21 | |
| 224.378 | |
| 224.38 | |
| Solid |
Safety and Handling
TSCA : No
Recommended Storage : Ambient temperatures
RUO – Research Use Only