missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1,1-Diphenylethylene, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 117260250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 1, 1-Diphenylethylene | |
| 97.5 | |
| 1.0200g/mL | |
| >112°C | |
| 97.5% min. (GC) | |
| C14H12 | |
| (C6H5)2C=CH2 | |
| 05,639 | |
| 15,3356 | |
| ZMYIIHDQURVDRB-UHFFFAOYSA-N | |
| 1-phenylethenylbenzene | |
| 10740 | |
| 98% |
| 530-48-3 | |
| 100.0 | |
| 270.0°C to 271.0°C | |
| Authentic | |
| Glass bottle | |
| 1.6065 to 1.6085 | |
| 25g | |
| 1.02 | |
| 1,1-diphenylethylene, ethene-1,1-diyldibenzene, 1,1-diphenylethene, benzene, 1,1'-ethenylidenebis, 1-phenylethenyl benzene, unii-bx0l5b6lll, as-diphenylethylene, .alpha.-phenylstyrene, 1-phenylvinyl benzene, bx0l5b6lll | |
| C=C(C1=CC=CC=C1)C2=CC=CC=C2 | |
| 180.25 | |
| 180.25 |
Chemical Identifiers
| 530-48-3 | |
| 180.25 | |
| 1,1-diphenylethylene, ethene-1,1-diyldibenzene, 1,1-diphenylethene, benzene, 1,1'-ethenylidenebis, 1-phenylethenyl benzene, unii-bx0l5b6lll, as-diphenylethylene, .alpha.-phenylstyrene, 1-phenylvinyl benzene, bx0l5b6lll | |
| 1-phenylethenylbenzene |
| C14H12 | |
| ZMYIIHDQURVDRB-UHFFFAOYSA-N | |
| 10740 | |
| C=C(C1=CC=CC=C1)C2=CC=CC=C2 |
Safety and Handling
EINECSNumber : 208-482-6
RUO â Research Use Only