Learn More
1-(1-Adamantyl)ethylamine hydrochloride, Thermo Scientific™
Supplier: Thermo Scientific Chemicals BTB12981DA
Specifications
| 1-(1-Adamantyl)ethylamine hydrochloride | |
| 94.5 | |
| 95% | |
| C12H22ClN | |
| 1 g | |
| OZBDFBJXRJWNAV-UHFFFAOYNA-N | |
| 1-(1-adamantyl)ethanamine;hydrochloride | |
| 15165 | |
| 215.77 |
| 1501-84-4 | |
| 100.0 | |
| Amber Glass Bottle | |
| MFCD00072023 | |
| rimantadine hydrochloride, flumadine, rimantadine hcl, meradane, 1-1-adamantyl ethylamine hydrochloride, 1-1-aminoethyl adamantane hydrochloride, alpha-methyl-1-adamantanemethylamine hydrochloride, 1-adamantan-1-yl ethanamine hydrochloride, algirem, meradan | |
| [H+].[Cl-].CC(N)C12CC3CC(CC(C3)C1)C2 | |
| 215.77 | |
| CHEBI:8865 | |
| 95% |
Chemical Identifiers
| 1501-84-4 | |
| 215.77 | |
| OZBDFBJXRJWNAV-UHFFFAOYNA-N | |
| 15165 | |
| 1-(1-adamantyl)ethanamine;hydrochloride |
| C12H22ClN | |
| MFCD00072023 | |
| rimantadine hydrochloride, flumadine, rimantadine hcl, meradane, 1-1-adamantyl ethylamine hydrochloride, 1-1-aminoethyl adamantane hydrochloride, alpha-methyl-1-adamantanemethylamine hydrochloride, 1-adamantan-1-yl ethanamine hydrochloride, algirem, meradan | |
| CHEBI:8865 | |
| [H+].[Cl-].CC(N)C12CC3CC(CC(C3)C1)C2 |
Safety and Handling
GHS H Statement:
Harmful if swallowed.
GHS P Statement:
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
GHS Signal Word: Warning