missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1,1,1-Trichloro-2-methyl-2-propanol Hemihydrate 98.0+%, TCI America™
Supplier: TCI America T0386500G
Specifications
| 1,1,1-Trichloro-2-methyl-2-propanol Hemihydrate | |
| 78°C | |
| 4.5 to 6 (8g/L H2O 20°C) | |
| C4H11Cl3O2 | |
| 500 g | |
| HBARVHNVVKZUGS-UHFFFAOYSA-N | |
| molecular hydrogen;1,1,1-trichloro-2-methylpropan-2-ol;hydrate | |
| 102594540 | |
| ≥98.0% (GC,T) |
| 6001-64-5 | |
| White-Yellow | |
| 175°C | |
| MFCD00004461 | |
| c4h7cl3o.1/2h2o, 1,1,1-trichloro-2-methyl-2-propanol hemihydrate, chlorobutanol hydrogen ion hydrate | |
| [HH].CC(C)(C(Cl)(Cl)Cl)O.O | |
| 197.48 | |
| 177.45 | |
| Crystalline Powder |
Chemical Identifiers
| 6001-64-5 | |
| 197.48 | |
| HBARVHNVVKZUGS-UHFFFAOYSA-N | |
| 102594540 | |
| [HH].CC(C)(C(Cl)(Cl)Cl)O.O |
| C4H11Cl3O2 | |
| MFCD00004461 | |
| c4h7cl3o.1/2h2o, 1,1,1-trichloro-2-methyl-2-propanol hemihydrate, chlorobutanol hydrogen ion hydrate | |
| molecular hydrogen;1,1,1-trichloro-2-methylpropan-2-ol;hydrate |
Safety and Handling
EINECSNumber : (2)-2002
TSCA : Yes