Inorganic Salts
Filtered Search Results
Osmium(III) chloride hydrate
CAS: 14996-60-2 Molecular Formula: Cl3H2OOs Molecular Weight (g/mol): 314.60 MDL Number: MFCD00149815 InChI Key: KHHOLOMEVBPRQY-UHFFFAOYSA-K Synonym: osmium iii chloride hydrate,osmium chloride oscl3 , hydrate 8ci,9ci,trichloroosmium hydrate,cl3os.h2o,trichloroosmium-water 1/1 PubChem CID: 16211485 SMILES: O.Cl[Os](Cl)Cl
| PubChem CID | 16211485 |
|---|---|
| CAS | 14996-60-2 |
| Molecular Weight (g/mol) | 314.60 |
| MDL Number | MFCD00149815 |
| SMILES | O.Cl[Os](Cl)Cl |
| Synonym | osmium iii chloride hydrate,osmium chloride oscl3 , hydrate 8ci,9ci,trichloroosmium hydrate,cl3os.h2o,trichloroosmium-water 1/1 |
| InChI Key | KHHOLOMEVBPRQY-UHFFFAOYSA-K |
| Molecular Formula | Cl3H2OOs |
Osmium tetroxide, 99.9+%, (trace metal basis)
CAS: 20816-12-0 Molecular Formula: O4Os Molecular Weight (g/mol): 254.23 MDL Number: MFCD00011150 InChI Key: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonym: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 PubChem CID: 30318 IUPAC Name: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| PubChem CID | 30318 |
|---|---|
| CAS | 20816-12-0 |
| Molecular Weight (g/mol) | 254.23 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os](=O)(=O)=O |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| IUPAC Name | tetraoxoosmium |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Molecular Formula | O4Os |
Osmium(IV) oxide, Os 83% min
CAS: 12036-02-1 Molecular Formula: O2Os Molecular Weight (g/mol): 222.228 MDL Number: MFCD00011150 InChI Key: XSXHWVKGUXMUQE-UHFFFAOYSA-N Synonym: osmium iv oxide,osmium dioxide,osmium oxide oso2 6ci,7ci,8ci,9ci,osmium iv-oxid,acmc-1btxg,osmium iv oxide, os PubChem CID: 187574 IUPAC Name: dioxoosmium SMILES: O=[Os]=O
| PubChem CID | 187574 |
|---|---|
| CAS | 12036-02-1 |
| Molecular Weight (g/mol) | 222.228 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os]=O |
| Synonym | osmium iv oxide,osmium dioxide,osmium oxide oso2 6ci,7ci,8ci,9ci,osmium iv-oxid,acmc-1btxg,osmium iv oxide, os |
| IUPAC Name | dioxoosmium |
| InChI Key | XSXHWVKGUXMUQE-UHFFFAOYSA-N |
| Molecular Formula | O2Os |
Osmium(VIII) oxide, 4% aq. soln.
CAS: 20816-12-0 Molecular Formula: O4Os Molecular Weight (g/mol): 254.23 MDL Number: MFCD00011150 InChI Key: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonym: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 PubChem CID: 30318 IUPAC Name: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| PubChem CID | 30318 |
|---|---|
| CAS | 20816-12-0 |
| Molecular Weight (g/mol) | 254.23 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os](=O)(=O)=O |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| IUPAC Name | tetraoxoosmium |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Molecular Formula | O4Os |
Osmium(VIII) oxide, 2% aq. soln.
CAS: 20816-12-0 Molecular Formula: O4Os Molecular Weight (g/mol): 254.23 MDL Number: MFCD00011150 InChI Key: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonym: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 PubChem CID: 30318 IUPAC Name: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| PubChem CID | 30318 |
|---|---|
| CAS | 20816-12-0 |
| Molecular Weight (g/mol) | 254.23 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os](=O)(=O)=O |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| IUPAC Name | tetraoxoosmium |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Molecular Formula | O4Os |
Potassium osmium(VI) oxide dihydrate, 98+%
CAS: 10022-66-9 Molecular Formula: H4K2O6Os Molecular Weight (g/mol): 368.453 MDL Number: MFCD00149919 InChI Key: DGODWNOPHMXOTR-UHFFFAOYSA-N Synonym: potassium osmate vi dihydrate,potassium dioxidodioxoosmium dihydrate,potassium osmate dihydrate,unii-5m2bwq2tyj,5m2bwq2tyj,osmate oso42-, dipotassium, dihydrate, t-4,dipotassium tetrahydroxodioxoosmate,potassium osmate k2oso2 oh 4,potassium osmate k2oso4 , dihydrate PubChem CID: 53393272 IUPAC Name: dipotassium;dioxido(dioxo)osmium;dihydrate SMILES: O.O.[O-][Os](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 53393272 |
|---|---|
| CAS | 10022-66-9 |
| Molecular Weight (g/mol) | 368.453 |
| MDL Number | MFCD00149919 |
| SMILES | O.O.[O-][Os](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium osmate vi dihydrate,potassium dioxidodioxoosmium dihydrate,potassium osmate dihydrate,unii-5m2bwq2tyj,5m2bwq2tyj,osmate oso42-, dipotassium, dihydrate, t-4,dipotassium tetrahydroxodioxoosmate,potassium osmate k2oso2 oh 4,potassium osmate k2oso4 , dihydrate |
| IUPAC Name | dipotassium;dioxido(dioxo)osmium;dihydrate |
| InChI Key | DGODWNOPHMXOTR-UHFFFAOYSA-N |
| Molecular Formula | H4K2O6Os |
| Linear Formula | OsO4 |
|---|---|
| Molecular Weight (g/mol) | 254.23 |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Density | 1.0400g/mL |
| PubChem CID | 30318 |
| Fieser | 01,759; 02,301; 04,361; 05,141; 06,424; 10,290; 12,358; 13,186; 14,235; 15,240; 16,249; 17,236 |
| RTECS Number | RN1140000 |
| Formula Weight | 254.2 |
| Boiling Point | 100.0°C |
| Color | Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Osmium tetroxide |
| SMILES | O=[Os](=O)(=O)=O |
| Merck Index | 15, 6990 |
| Concentration or Composition (by Analyte or Components) | 3.92 to 4.08% |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Immediately call a POISON CENTER or doctor/physician. IF INHALED: Remove to fresh air a |
| MDL Number | MFCD00011150 |
| Health Hazard 2 | GHS H Statement Causes serious eye damage. Fatal in contact with skin. Harmful if swallowed. Causes skin irritation. Harmful if inhaled. May cause allergy or asthma symptoms or breathing difficulties if inhaled. |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: soluble |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| TSCA | TSCA |
| IUPAC Name | tetraoxoosmium |
| Molecular Formula | O4Os |
| EINECS Number | 244-058-7 |
| Specific Gravity | 1.04 |
Osmium tetroxide, 2.5 wt.% solution in tert-Butanol, stabilized
CAS: 20816-12-0 | O4Os | 254.23 g/mol
| Linear Formula | OsO4 |
|---|---|
| Molecular Weight (g/mol) | 254.23 |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Density | 0.8110g/mL |
| PubChem CID | 30318 |
| Fieser | 01,759; 02,301; 04,361; 05,141; 06,424; 10,290; 12,358; 13,186; 14,235; 15,240; 16,249; 17,236 |
| RTECS Number | RN1140000 |
| Formula Weight | 254.2 |
| Color | White to Yellow |
| Physical Form | Crystals, Fused Mass or Solution |
| Chemical Name or Material | Osmium tetroxide |
| SMILES | O=[Os](=O)(=O)=O |
| Merck Index | 15, 6990 |
| Concentration or Composition (by Analyte or Components) | 2.5 wt% Min. |
| CAS | 75-65-0 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rin |
| MDL Number | MFCD00011150 |
| Health Hazard 2 | GHS H Statement Toxic if inhaled. Harmful if swallowed. Fatal in contact with skin. Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. May cause allergy or asthma symptoms o |
| Packaging | Glass bottle |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| TSCA | TSCA |
| IUPAC Name | tetraoxoosmium |
| Molecular Formula | O4Os |
| EINECS Number | 244-058-7 |
| Specific Gravity | 0.811 |
Osmium(VIII) oxide, 99.8% (metals basis), Os 74.4% min
CAS: 20816-12-0 Molecular Formula: O4Os Molecular Weight (g/mol): 254.23 MDL Number: MFCD00011150 InChI Key: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonym: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 PubChem CID: 30318 IUPAC Name: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| PubChem CID | 30318 |
|---|---|
| CAS | 20816-12-0 |
| Molecular Weight (g/mol) | 254.23 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os](=O)(=O)=O |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| IUPAC Name | tetraoxoosmium |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Molecular Formula | O4Os |
Osmium(III) chloride trihydrate, Premion™, 99.99% (metals basis), Os 52-56%
CAS: 135296-80-9 Molecular Formula: Cl3H6O3Os Molecular Weight (g/mol): 350.625 MDL Number: MFCD00011148 InChI Key: UACQLNPCDXDCID-UHFFFAOYSA-K Synonym: osmium iii chloride trihydrate,osmium trichloride trihydrate,cl3os.3h2o,acmc-20ak04,trichloroosmium-water 1/3,trichloroosmium trihydrate,osmium iii chloride trihydrate, premion PubChem CID: 57348105 IUPAC Name: trichloroosmium;trihydrate SMILES: O.O.O.Cl[Os](Cl)Cl
| PubChem CID | 57348105 |
|---|---|
| CAS | 135296-80-9 |
| Molecular Weight (g/mol) | 350.625 |
| MDL Number | MFCD00011148 |
| SMILES | O.O.O.Cl[Os](Cl)Cl |
| Synonym | osmium iii chloride trihydrate,osmium trichloride trihydrate,cl3os.3h2o,acmc-20ak04,trichloroosmium-water 1/3,trichloroosmium trihydrate,osmium iii chloride trihydrate, premion |
| IUPAC Name | trichloroosmium;trihydrate |
| InChI Key | UACQLNPCDXDCID-UHFFFAOYSA-K |
| Molecular Formula | Cl3H6O3Os |
Ammonium hexachloroosmate(IV), Premion™, 99.99% (metals basis), Os 42.8% min
CAS: 12125-08-5 Molecular Formula: Cl6H8N2Os Molecular Weight (g/mol): 439.00 MDL Number: MFCD00010883 InChI Key: JRHMYOOMZKAPKT-UHFFFAOYSA-J Synonym: ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion PubChem CID: 11729867 SMILES: [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl
| PubChem CID | 11729867 |
|---|---|
| CAS | 12125-08-5 |
| Molecular Weight (g/mol) | 439.00 |
| MDL Number | MFCD00010883 |
| SMILES | [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl |
| Synonym | ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion |
| InChI Key | JRHMYOOMZKAPKT-UHFFFAOYSA-J |
| Molecular Formula | Cl6H8N2Os |
Ammonium hexachloroosmate(IV), 99.99%, (trace metal basis)
CAS: 12125-08-5 Molecular Formula: Cl6H8N2Os Molecular Weight (g/mol): 439.00 MDL Number: MFCD00010883 InChI Key: JRHMYOOMZKAPKT-UHFFFAOYSA-J Synonym: ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion PubChem CID: 11729867 IUPAC Name: diammonium hexachloroosmiumtetrakis(ylium) SMILES: [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl
| PubChem CID | 11729867 |
|---|---|
| CAS | 12125-08-5 |
| Molecular Weight (g/mol) | 439.00 |
| MDL Number | MFCD00010883 |
| SMILES | [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl |
| Synonym | ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion |
| IUPAC Name | diammonium hexachloroosmiumtetrakis(ylium) |
| InChI Key | JRHMYOOMZKAPKT-UHFFFAOYSA-J |
| Molecular Formula | Cl6H8N2Os |
Ammonium hexachloroosmate(IV), 99.9% (metals basis), Os 42.5% min
CAS: 12125-08-5 Molecular Formula: Cl6H8N2Os Molecular Weight (g/mol): 439.00 MDL Number: MFCD00010883 InChI Key: JRHMYOOMZKAPKT-UHFFFAOYSA-J Synonym: ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion PubChem CID: 11729867 IUPAC Name: diazanium;hexachloroosmium(2-) SMILES: [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl
| PubChem CID | 11729867 |
|---|---|
| CAS | 12125-08-5 |
| Molecular Weight (g/mol) | 439.00 |
| MDL Number | MFCD00010883 |
| SMILES | [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl |
| Synonym | ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion |
| IUPAC Name | diazanium;hexachloroosmium(2-) |
| InChI Key | JRHMYOOMZKAPKT-UHFFFAOYSA-J |
| Molecular Formula | Cl6H8N2Os |