Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Osmium(III) chloride hydrate
CAS: 14996-60-2 Molecular Formula: Cl3H2OOs Molecular Weight (g/mol): 314.60 MDL Number: MFCD00149815 InChI Key: KHHOLOMEVBPRQY-UHFFFAOYSA-K Synonym: osmium iii chloride hydrate,osmium chloride oscl3 , hydrate 8ci,9ci,trichloroosmium hydrate,cl3os.h2o,trichloroosmium-water 1/1 PubChem CID: 16211485 SMILES: O.Cl[Os](Cl)Cl
| PubChem CID | 16211485 |
|---|---|
| CAS | 14996-60-2 |
| Molecular Weight (g/mol) | 314.60 |
| MDL Number | MFCD00149815 |
| SMILES | O.Cl[Os](Cl)Cl |
| Synonym | osmium iii chloride hydrate,osmium chloride oscl3 , hydrate 8ci,9ci,trichloroosmium hydrate,cl3os.h2o,trichloroosmium-water 1/1 |
| InChI Key | KHHOLOMEVBPRQY-UHFFFAOYSA-K |
| Molecular Formula | Cl3H2OOs |
Osmium, 99.9%, (trace metal basis)
CAS: 4-2-7440 Molecular Formula: Os Molecular Weight (g/mol): 190.23 MDL Number: MFCD00011147 InChI Key: SYQBFIAQOQZEGI-UHFFFAOYSA-N Synonym: ion,metallic,osmium, elemental,unii-2e7m255opy,os4,osmio,hydrido,hydride,atom,powder PubChem CID: 23937 ChEBI: CHEBI:30687 IUPAC Name: osmium SMILES: [Os]
| PubChem CID | 23937 |
|---|---|
| CAS | 4-2-7440 |
| Molecular Weight (g/mol) | 190.23 |
| ChEBI | CHEBI:30687 |
| MDL Number | MFCD00011147 |
| SMILES | [Os] |
| Synonym | ion,metallic,osmium, elemental,unii-2e7m255opy,os4,osmio,hydrido,hydride,atom,powder |
| IUPAC Name | osmium |
| InChI Key | SYQBFIAQOQZEGI-UHFFFAOYSA-N |
| Molecular Formula | Os |
Osmium tetroxide, 99.9+%, (trace metal basis)
CAS: 20816-12-0 Molecular Formula: O4Os Molecular Weight (g/mol): 254.23 MDL Number: MFCD00011150 InChI Key: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonym: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 PubChem CID: 30318 IUPAC Name: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| PubChem CID | 30318 |
|---|---|
| CAS | 20816-12-0 |
| Molecular Weight (g/mol) | 254.23 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os](=O)(=O)=O |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| IUPAC Name | tetraoxoosmium |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Molecular Formula | O4Os |
Osmium(IV) oxide, Os 83% min
CAS: 12036-02-1 Molecular Formula: O2Os Molecular Weight (g/mol): 222.228 MDL Number: MFCD00011150 InChI Key: XSXHWVKGUXMUQE-UHFFFAOYSA-N Synonym: osmium iv oxide,osmium dioxide,osmium oxide oso2 6ci,7ci,8ci,9ci,osmium iv-oxid,acmc-1btxg,osmium iv oxide, os PubChem CID: 187574 IUPAC Name: dioxoosmium SMILES: O=[Os]=O
| PubChem CID | 187574 |
|---|---|
| CAS | 12036-02-1 |
| Molecular Weight (g/mol) | 222.228 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os]=O |
| Synonym | osmium iv oxide,osmium dioxide,osmium oxide oso2 6ci,7ci,8ci,9ci,osmium iv-oxid,acmc-1btxg,osmium iv oxide, os |
| IUPAC Name | dioxoosmium |
| InChI Key | XSXHWVKGUXMUQE-UHFFFAOYSA-N |
| Molecular Formula | O2Os |
| Linear Formula | OsO4 |
|---|---|
| Molecular Weight (g/mol) | 254.23 |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Density | 1.0400g/mL |
| PubChem CID | 30318 |
| Fieser | 01,759; 02,301; 04,361; 05,141; 06,424; 10,290; 12,358; 13,186; 14,235; 15,240; 16,249; 17,236 |
| RTECS Number | RN1140000 |
| Formula Weight | 254.2 |
| Boiling Point | 100.0°C |
| Color | Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Osmium tetroxide |
| SMILES | O=[Os](=O)(=O)=O |
| Merck Index | 15, 6990 |
| Concentration or Composition (by Analyte or Components) | 3.92 to 4.08% |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Immediately call a POISON CENTER or doctor/physician. IF INHALED: Remove to fresh air a |
| MDL Number | MFCD00011150 |
| Health Hazard 2 | GHS H Statement Causes serious eye damage. Fatal in contact with skin. Harmful if swallowed. Causes skin irritation. Harmful if inhaled. May cause allergy or asthma symptoms or breathing difficulties if inhaled. |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: soluble |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| TSCA | TSCA |
| IUPAC Name | tetraoxoosmium |
| Molecular Formula | O4Os |
| EINECS Number | 244-058-7 |
| Specific Gravity | 1.04 |
Osmium(VIII) oxide, 4% aq. soln.
CAS: 20816-12-0 Molecular Formula: O4Os Molecular Weight (g/mol): 254.23 MDL Number: MFCD00011150 InChI Key: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonym: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 PubChem CID: 30318 IUPAC Name: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| PubChem CID | 30318 |
|---|---|
| CAS | 20816-12-0 |
| Molecular Weight (g/mol) | 254.23 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os](=O)(=O)=O |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| IUPAC Name | tetraoxoosmium |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Molecular Formula | O4Os |
Osmium(VIII) oxide, 2% aq. soln.
CAS: 20816-12-0 Molecular Formula: O4Os Molecular Weight (g/mol): 254.23 MDL Number: MFCD00011150 InChI Key: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonym: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 PubChem CID: 30318 IUPAC Name: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| PubChem CID | 30318 |
|---|---|
| CAS | 20816-12-0 |
| Molecular Weight (g/mol) | 254.23 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os](=O)(=O)=O |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| IUPAC Name | tetraoxoosmium |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Molecular Formula | O4Os |
Potassium osmium(VI) oxide dihydrate, 98+%
CAS: 10022-66-9 Molecular Formula: H4K2O6Os Molecular Weight (g/mol): 368.453 MDL Number: MFCD00149919 InChI Key: DGODWNOPHMXOTR-UHFFFAOYSA-N Synonym: potassium osmate vi dihydrate,potassium dioxidodioxoosmium dihydrate,potassium osmate dihydrate,unii-5m2bwq2tyj,5m2bwq2tyj,osmate oso42-, dipotassium, dihydrate, t-4,dipotassium tetrahydroxodioxoosmate,potassium osmate k2oso2 oh 4,potassium osmate k2oso4 , dihydrate PubChem CID: 53393272 IUPAC Name: dipotassium;dioxido(dioxo)osmium;dihydrate SMILES: O.O.[O-][Os](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 53393272 |
|---|---|
| CAS | 10022-66-9 |
| Molecular Weight (g/mol) | 368.453 |
| MDL Number | MFCD00149919 |
| SMILES | O.O.[O-][Os](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium osmate vi dihydrate,potassium dioxidodioxoosmium dihydrate,potassium osmate dihydrate,unii-5m2bwq2tyj,5m2bwq2tyj,osmate oso42-, dipotassium, dihydrate, t-4,dipotassium tetrahydroxodioxoosmate,potassium osmate k2oso2 oh 4,potassium osmate k2oso4 , dihydrate |
| IUPAC Name | dipotassium;dioxido(dioxo)osmium;dihydrate |
| InChI Key | DGODWNOPHMXOTR-UHFFFAOYSA-N |
| Molecular Formula | H4K2O6Os |
Osmium powder, -200 mesh, 99.8% (metals basis)
CAS: 4-2-7440 Molecular Formula: Os Molecular Weight (g/mol): 190.23 MDL Number: MFCD00011147 InChI Key: SYQBFIAQOQZEGI-UHFFFAOYSA-N Synonym: ion,metallic,osmium, elemental,unii-2e7m255opy,os4,osmio,hydrido,hydride,atom,powder PubChem CID: 23937 ChEBI: CHEBI:30687 IUPAC Name: osmium SMILES: [Os]
| PubChem CID | 23937 |
|---|---|
| CAS | 4-2-7440 |
| Molecular Weight (g/mol) | 190.23 |
| ChEBI | CHEBI:30687 |
| MDL Number | MFCD00011147 |
| SMILES | [Os] |
| Synonym | ion,metallic,osmium, elemental,unii-2e7m255opy,os4,osmio,hydrido,hydride,atom,powder |
| IUPAC Name | osmium |
| InChI Key | SYQBFIAQOQZEGI-UHFFFAOYSA-N |
| Molecular Formula | Os |
Osmium powder, -20 mesh, 99.95% (metals basis)
CAS: 4-2-7440 PubChem CID: 23937 ChEBI: CHEBI:30687 IUPAC Name: osmium
| PubChem CID | 23937 |
|---|---|
| CAS | 4-2-7440 |
| ChEBI | CHEBI:30687 |
| IUPAC Name | osmium |
Osmium tetroxide, 2.5 wt.% solution in tert-Butanol, stabilized
CAS: 20816-12-0 | O4Os | 254.23 g/mol
| Linear Formula | OsO4 |
|---|---|
| Molecular Weight (g/mol) | 254.23 |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Density | 0.8110g/mL |
| PubChem CID | 30318 |
| Fieser | 01,759; 02,301; 04,361; 05,141; 06,424; 10,290; 12,358; 13,186; 14,235; 15,240; 16,249; 17,236 |
| RTECS Number | RN1140000 |
| Formula Weight | 254.2 |
| Color | White to Yellow |
| Physical Form | Crystals, Fused Mass or Solution |
| Chemical Name or Material | Osmium tetroxide |
| SMILES | O=[Os](=O)(=O)=O |
| Merck Index | 15, 6990 |
| Concentration or Composition (by Analyte or Components) | 2.5 wt% Min. |
| CAS | 75-65-0 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rin |
| MDL Number | MFCD00011150 |
| Health Hazard 2 | GHS H Statement Toxic if inhaled. Harmful if swallowed. Fatal in contact with skin. Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. May cause allergy or asthma symptoms o |
| Packaging | Glass bottle |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| TSCA | TSCA |
| IUPAC Name | tetraoxoosmium |
| Molecular Formula | O4Os |
| EINECS Number | 244-058-7 |
| Specific Gravity | 0.811 |
Osmium(VIII) oxide, 99.8% (metals basis), Os 74.4% min
CAS: 20816-12-0 Molecular Formula: O4Os Molecular Weight (g/mol): 254.23 MDL Number: MFCD00011150 InChI Key: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonym: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 PubChem CID: 30318 IUPAC Name: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| PubChem CID | 30318 |
|---|---|
| CAS | 20816-12-0 |
| Molecular Weight (g/mol) | 254.23 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os](=O)(=O)=O |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| IUPAC Name | tetraoxoosmium |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Molecular Formula | O4Os |
Osmium(III) chloride trihydrate, Premion™, 99.99% (metals basis), Os 52-56%
CAS: 135296-80-9 Molecular Formula: Cl3H6O3Os Molecular Weight (g/mol): 350.625 MDL Number: MFCD00011148 InChI Key: UACQLNPCDXDCID-UHFFFAOYSA-K Synonym: osmium iii chloride trihydrate,osmium trichloride trihydrate,cl3os.3h2o,acmc-20ak04,trichloroosmium-water 1/3,trichloroosmium trihydrate,osmium iii chloride trihydrate, premion PubChem CID: 57348105 IUPAC Name: trichloroosmium;trihydrate SMILES: O.O.O.Cl[Os](Cl)Cl
| PubChem CID | 57348105 |
|---|---|
| CAS | 135296-80-9 |
| Molecular Weight (g/mol) | 350.625 |
| MDL Number | MFCD00011148 |
| SMILES | O.O.O.Cl[Os](Cl)Cl |
| Synonym | osmium iii chloride trihydrate,osmium trichloride trihydrate,cl3os.3h2o,acmc-20ak04,trichloroosmium-water 1/3,trichloroosmium trihydrate,osmium iii chloride trihydrate, premion |
| IUPAC Name | trichloroosmium;trihydrate |
| InChI Key | UACQLNPCDXDCID-UHFFFAOYSA-K |
| Molecular Formula | Cl3H6O3Os |
Ammonium hexachloroosmate(IV), Premion™, 99.99% (metals basis), Os 42.8% min
CAS: 12125-08-5 Molecular Formula: Cl6H8N2Os Molecular Weight (g/mol): 439.00 MDL Number: MFCD00010883 InChI Key: JRHMYOOMZKAPKT-UHFFFAOYSA-J Synonym: ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion PubChem CID: 11729867 SMILES: [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl
| PubChem CID | 11729867 |
|---|---|
| CAS | 12125-08-5 |
| Molecular Weight (g/mol) | 439.00 |
| MDL Number | MFCD00010883 |
| SMILES | [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl |
| Synonym | ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion |
| InChI Key | JRHMYOOMZKAPKT-UHFFFAOYSA-J |
| Molecular Formula | Cl6H8N2Os |
Ammonium hexachloroosmate(IV), 99.99%, (trace metal basis)
CAS: 12125-08-5 Molecular Formula: Cl6H8N2Os Molecular Weight (g/mol): 439.00 MDL Number: MFCD00010883 InChI Key: JRHMYOOMZKAPKT-UHFFFAOYSA-J Synonym: ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion PubChem CID: 11729867 IUPAC Name: diammonium hexachloroosmiumtetrakis(ylium) SMILES: [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl
| PubChem CID | 11729867 |
|---|---|
| CAS | 12125-08-5 |
| Molecular Weight (g/mol) | 439.00 |
| MDL Number | MFCD00010883 |
| SMILES | [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl |
| Synonym | ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion |
| IUPAC Name | diammonium hexachloroosmiumtetrakis(ylium) |
| InChI Key | JRHMYOOMZKAPKT-UHFFFAOYSA-J |
| Molecular Formula | Cl6H8N2Os |