Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Manganese(IV) oxide, 97%
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |
Manganese(III) oxide, 98%
CAS: 1317-34-6 Molecular Formula: Mn2O3 Molecular Weight (g/mol): 157.873 MDL Number: MFCD00016217 InChI Key: GEYXPJBPASPPLI-UHFFFAOYSA-N Synonym: manganese iii oxide,manganic oxide,dimanganese trioxide,manganese sesquioxide,manganese trioxide,manganese manganate,manganese sisquioxide,manganese 3+ oxide,manganese oxide,oxo oxomanganiooxy manganese PubChem CID: 14824 IUPAC Name: oxo(oxomanganiooxy)manganese SMILES: O=[Mn]O[Mn]=O
| PubChem CID | 14824 |
|---|---|
| CAS | 1317-34-6 |
| Molecular Weight (g/mol) | 157.873 |
| MDL Number | MFCD00016217 |
| SMILES | O=[Mn]O[Mn]=O |
| Synonym | manganese iii oxide,manganic oxide,dimanganese trioxide,manganese sesquioxide,manganese trioxide,manganese manganate,manganese sisquioxide,manganese 3+ oxide,manganese oxide,oxo oxomanganiooxy manganese |
| IUPAC Name | oxo(oxomanganiooxy)manganese |
| InChI Key | GEYXPJBPASPPLI-UHFFFAOYSA-N |
| Molecular Formula | Mn2O3 |
Manganese(II) fluoride, 99%
CAS: 7782-64-1 Molecular Formula: F2Mn Molecular Weight (g/mol): 92.935 MDL Number: MFCD00016222 InChI Key: CTNMMTCXUUFYAP-UHFFFAOYSA-L Synonym: manganese ii fluoride,manganese fluoride mnf2,manganese fluorure french,manganese fluorure,mnf2,manganese fluoride di,manganese ii fluoride, anhydrous trace metals basis PubChem CID: 24528 IUPAC Name: difluoromanganese SMILES: F[Mn]F
| PubChem CID | 24528 |
|---|---|
| CAS | 7782-64-1 |
| Molecular Weight (g/mol) | 92.935 |
| MDL Number | MFCD00016222 |
| SMILES | F[Mn]F |
| Synonym | manganese ii fluoride,manganese fluoride mnf2,manganese fluorure french,manganese fluorure,mnf2,manganese fluoride di,manganese ii fluoride, anhydrous trace metals basis |
| IUPAC Name | difluoromanganese |
| InChI Key | CTNMMTCXUUFYAP-UHFFFAOYSA-L |
| Molecular Formula | F2Mn |
Manganese(II) chloride, 97%
CAS: 7773-01-5 Molecular Formula: Cl2Mn Molecular Weight (g/mol): 125.84 MDL Number: MFCD00011114 InChI Key: GLFNIEUTAYBVOC-UHFFFAOYSA-L Synonym: manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline PubChem CID: 10313134 ChEBI: CHEBI:63041 SMILES: [Cl-].[Cl-].[Mn++]
| PubChem CID | 10313134 |
|---|---|
| CAS | 7773-01-5 |
| Molecular Weight (g/mol) | 125.84 |
| ChEBI | CHEBI:63041 |
| MDL Number | MFCD00011114 |
| SMILES | [Cl-].[Cl-].[Mn++] |
| Synonym | manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline |
| InChI Key | GLFNIEUTAYBVOC-UHFFFAOYSA-L |
| Molecular Formula | Cl2Mn |
Manganese(II) chloride, 97%
CAS: 7773-01-5 Molecular Formula: Cl2Mn Molecular Weight (g/mol): 125.84 MDL Number: MFCD00011114 InChI Key: GLFNIEUTAYBVOC-UHFFFAOYSA-L Synonym: manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline PubChem CID: 10313134 ChEBI: CHEBI:63041 SMILES: [Cl-].[Cl-].[Mn++]
| PubChem CID | 10313134 |
|---|---|
| CAS | 7773-01-5 |
| Molecular Weight (g/mol) | 125.84 |
| ChEBI | CHEBI:63041 |
| MDL Number | MFCD00011114 |
| SMILES | [Cl-].[Cl-].[Mn++] |
| Synonym | manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline |
| InChI Key | GLFNIEUTAYBVOC-UHFFFAOYSA-L |
| Molecular Formula | Cl2Mn |
Manganese telluride, 99.9% (metals basis)
CAS: 12032-88-1 Molecular Formula: MnTe Molecular Weight (g/mol): 182.54 MDL Number: MFCD00049487 InChI Key: VMINMXIEZOMBRH-UHFFFAOYSA-N Synonym: manganese telluride,telluroxomanganese,manganese monotelluride,manganous telluride,manganese ii telluride,manganese 2+ telluride PubChem CID: 82828 IUPAC Name: tellanylidenemanganese SMILES: [Mn]=[Te]
| PubChem CID | 82828 |
|---|---|
| CAS | 12032-88-1 |
| Molecular Weight (g/mol) | 182.54 |
| MDL Number | MFCD00049487 |
| SMILES | [Mn]=[Te] |
| Synonym | manganese telluride,telluroxomanganese,manganese monotelluride,manganous telluride,manganese ii telluride,manganese 2+ telluride |
| IUPAC Name | tellanylidenemanganese |
| InChI Key | VMINMXIEZOMBRH-UHFFFAOYSA-N |
| Molecular Formula | MnTe |
Manganese(II) acetate, 98+%, anhydrous
CAS: 638-38-0 Molecular Formula: C4H6MnO4 Molecular Weight (g/mol): 173.03 MDL Number: MFCD00013039 InChI Key: UOGMEBQRZBEZQT-UHFFFAOYSA-L Synonym: manganese ii acetate,manganese acetate,manganous acetate,diacetylmanganese,manganese diacetate,manganese di acetate,manganese 2+ acetate,octan manganaty czech,acetic acid, manganese 2+ salt,unii-0v6e9q2i0y PubChem CID: 12525 IUPAC Name: manganese(2+);diacetate SMILES: [Mn++].CC([O-])=O.CC([O-])=O
| PubChem CID | 12525 |
|---|---|
| CAS | 638-38-0 |
| Molecular Weight (g/mol) | 173.03 |
| MDL Number | MFCD00013039 |
| SMILES | [Mn++].CC([O-])=O.CC([O-])=O |
| Synonym | manganese ii acetate,manganese acetate,manganous acetate,diacetylmanganese,manganese diacetate,manganese di acetate,manganese 2+ acetate,octan manganaty czech,acetic acid, manganese 2+ salt,unii-0v6e9q2i0y |
| IUPAC Name | manganese(2+);diacetate |
| InChI Key | UOGMEBQRZBEZQT-UHFFFAOYSA-L |
| Molecular Formula | C4H6MnO4 |
Manganese, 99+%, powder, -40 mesh
CAS: 7439-96-5 Molecular Formula: Mn Molecular Weight (g/mol): 54.94 MDL Number: MFCD00011111 InChI Key: PWHULOQIROXLJO-UHFFFAOYSA-N Synonym: colloidal,mangan,manganese, elemental,cutaval,magnacat,metal alloy,tronamang,fume,mangan polish,compounds PubChem CID: 23930 ChEBI: CHEBI:35154 IUPAC Name: manganese SMILES: [Mn]
| PubChem CID | 23930 |
|---|---|
| CAS | 7439-96-5 |
| Molecular Weight (g/mol) | 54.94 |
| ChEBI | CHEBI:35154 |
| MDL Number | MFCD00011111 |
| SMILES | [Mn] |
| Synonym | colloidal,mangan,manganese, elemental,cutaval,magnacat,metal alloy,tronamang,fume,mangan polish,compounds |
| IUPAC Name | manganese |
| InChI Key | PWHULOQIROXLJO-UHFFFAOYSA-N |
| Molecular Formula | Mn |
Manganese(II) sulfate monohydrate, 99%
CAS: 10034-96-5 Molecular Formula: H2MnO5S Molecular Weight (g/mol): 169.01 MDL Number: MFCD00149159 InChI Key: ISPYRSDWRDQNSW-UHFFFAOYSA-L Synonym: manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate PubChem CID: 177577 ChEBI: CHEBI:86364 IUPAC Name: manganese(2+);sulfate;hydrate SMILES: O.[Mn++].[O-]S([O-])(=O)=O
| PubChem CID | 177577 |
|---|---|
| CAS | 10034-96-5 |
| Molecular Weight (g/mol) | 169.01 |
| ChEBI | CHEBI:86364 |
| MDL Number | MFCD00149159 |
| SMILES | O.[Mn++].[O-]S([O-])(=O)=O |
| Synonym | manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate |
| IUPAC Name | manganese(2+);sulfate;hydrate |
| InChI Key | ISPYRSDWRDQNSW-UHFFFAOYSA-L |
| Molecular Formula | H2MnO5S |
Manganese(II) sulfate monohydrate, 97%
CAS: 10034-96-5 Molecular Formula: H2MnO5S Molecular Weight (g/mol): 169.01 MDL Number: MFCD00149159 InChI Key: ISPYRSDWRDQNSW-UHFFFAOYSA-L Synonym: manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate PubChem CID: 177577 ChEBI: CHEBI:86364 SMILES: O.[Mn++].[O-]S([O-])(=O)=O
| PubChem CID | 177577 |
|---|---|
| CAS | 10034-96-5 |
| Molecular Weight (g/mol) | 169.01 |
| ChEBI | CHEBI:86364 |
| MDL Number | MFCD00149159 |
| SMILES | O.[Mn++].[O-]S([O-])(=O)=O |
| Synonym | manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate |
| InChI Key | ISPYRSDWRDQNSW-UHFFFAOYSA-L |
| Molecular Formula | H2MnO5S |
Manganese(II) bromide hydrate, 98%
CAS: 10031-20-6 Molecular Formula: Br2H8MnO4 Molecular Weight (g/mol): 286.81 MDL Number: MFCD00149791 InChI Key: HHDPJRSXPOGIOP-UHFFFAOYSA-L Synonym: manganese bromide tetrahydrate,unii-8308v6rbj5,manganese ii bromide hexahydrate,manganous bromide tetrahydrate,manganese dibromide tetrahydrate,manganese bromide mnbr2 , tetrahydrate,manganese 2+ ion tetrahydrate dibromide IUPAC Name: manganese(2+) tetrahydrate dibromide SMILES: O.O.O.O.[Mn++].[Br-].[Br-]
| CAS | 10031-20-6 |
|---|---|
| Molecular Weight (g/mol) | 286.81 |
| MDL Number | MFCD00149791 |
| SMILES | O.O.O.O.[Mn++].[Br-].[Br-] |
| Synonym | manganese bromide tetrahydrate,unii-8308v6rbj5,manganese ii bromide hexahydrate,manganous bromide tetrahydrate,manganese dibromide tetrahydrate,manganese bromide mnbr2 , tetrahydrate,manganese 2+ ion tetrahydrate dibromide |
| IUPAC Name | manganese(2+) tetrahydrate dibromide |
| InChI Key | HHDPJRSXPOGIOP-UHFFFAOYSA-L |
| Molecular Formula | Br2H8MnO4 |
Manganese(II) nitrate tetrahydrate, 98%
CAS: 20694-39-7 Molecular Formula: H8MnN2O10 Molecular Weight (g/mol): 251.006 MDL Number: MFCD00149789 InChI Key: ALIMWUQMDCBYFM-UHFFFAOYSA-N Synonym: manganese ii nitrate tetrahydrate,manganese nitrate tetrahydrate,unii-03m0g68r5f,manganese 2+ ion tetrahydrate dinitrate,manganese dinitrate tetrahydrate,acmc-20akkk,nitric acid, manganese 2+ salt, tetrahydrate,ksc206g2f,mn.2no3.4h2o,manganese 2+ dinitrate tetrahydrate PubChem CID: 182616 IUPAC Name: manganese(2+);dinitrate;tetrahydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.[Mn+2]
| PubChem CID | 182616 |
|---|---|
| CAS | 20694-39-7 |
| Molecular Weight (g/mol) | 251.006 |
| MDL Number | MFCD00149789 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.[Mn+2] |
| Synonym | manganese ii nitrate tetrahydrate,manganese nitrate tetrahydrate,unii-03m0g68r5f,manganese 2+ ion tetrahydrate dinitrate,manganese dinitrate tetrahydrate,acmc-20akkk,nitric acid, manganese 2+ salt, tetrahydrate,ksc206g2f,mn.2no3.4h2o,manganese 2+ dinitrate tetrahydrate |
| IUPAC Name | manganese(2+);dinitrate;tetrahydrate |
| InChI Key | ALIMWUQMDCBYFM-UHFFFAOYSA-N |
| Molecular Formula | H8MnN2O10 |
Manganese phosphide, 99% (metals basis)
CAS: 12263-33-1 Molecular Formula: Mn3P2 Molecular Weight (g/mol): 226.76 MDL Number: MFCD00064736 InChI Key: ZZDYLDYDQHMVJZ-UHFFFAOYSA-N IUPAC Name: trimanganese(2+) diphosphanetriide SMILES: [P-3].[P-3].[Mn++].[Mn++].[Mn++]
| CAS | 12263-33-1 |
|---|---|
| Molecular Weight (g/mol) | 226.76 |
| MDL Number | MFCD00064736 |
| SMILES | [P-3].[P-3].[Mn++].[Mn++].[Mn++] |
| IUPAC Name | trimanganese(2+) diphosphanetriide |
| InChI Key | ZZDYLDYDQHMVJZ-UHFFFAOYSA-N |
| Molecular Formula | Mn3P2 |
Manganese(II) bromide, 99%, anhydrous
CAS: 13446-03-2 Molecular Formula: Br2Mn Molecular Weight (g/mol): 214.76 MDL Number: MFCD00011113
| CAS | 13446-03-2 |
|---|---|
| Molecular Weight (g/mol) | 214.76 |
| MDL Number | MFCD00011113 |
| Molecular Formula | Br2Mn |
Manganese nanopowder, APS 30-50nm
CAS: 7439-96-5 Molecular Formula: Mn Molecular Weight (g/mol): 54.94 MDL Number: MFCD00011111 InChI Key: PWHULOQIROXLJO-UHFFFAOYSA-N Synonym: colloidal,mangan,manganese, elemental,cutaval,magnacat,metal alloy,tronamang,fume,mangan polish,compounds PubChem CID: 23930 ChEBI: CHEBI:35154 IUPAC Name: manganese SMILES: [Mn]
| PubChem CID | 23930 |
|---|---|
| CAS | 7439-96-5 |
| Molecular Weight (g/mol) | 54.94 |
| ChEBI | CHEBI:35154 |
| MDL Number | MFCD00011111 |
| SMILES | [Mn] |
| Synonym | colloidal,mangan,manganese, elemental,cutaval,magnacat,metal alloy,tronamang,fume,mangan polish,compounds |
| IUPAC Name | manganese |
| InChI Key | PWHULOQIROXLJO-UHFFFAOYSA-N |
| Molecular Formula | Mn |