Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Glutaric dialdehyde, electron microscopy grade, 25% solution in water, purified
CAS: 111-30-8 | C5H8O2 | 100.12 g/mol
| Linear Formula | OHC(CH2)3CHO |
|---|---|
| Molecular Weight (g/mol) | 100.12 |
| ChEBI | CHEBI:64276 |
| InChI Key | SXRSQZLOMIGNAQ-UHFFFAOYSA-N |
| Density | 1.0600g/mL |
| PubChem CID | 3485 |
| Name Note | Purified |
| Percent Purity | 25 to 27 wt% |
| Fieser | 01,411 |
| pH | 3.1 to 4.5 (25°C) |
| Formula Weight | 100.12 |
| Melting Point | -5.0°C |
| Boiling Point | 101°C |
| Physical Form | Solution |
| Chemical Name or Material | Glutaric dialdehyde, electron microscopy grade |
| Grade | E.M. |
| SMILES | O=CCCCC=O |
| Merck Index | 15, 4508 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER |
| MDL Number | MFCD00007025 |
| Health Hazard 2 | GHS H Statement May cause an allergic skin reaction. May cause allergy or asthma symptoms or breathing difficulties if inhaled. Causes severe skin burns and eye damage. Harmful if swallowed. Harmful if inhaled. Very t |
| Solubility Information | Solubility in water: soluble |
| Packaging | Glass bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.373 |
| Synonym | glutaraldehyde,glutaral,glutaric dialdehyde,cidex,glutardialdehyde,1,5-pentanedial,sonacide,glutarol,aldesan,glutaric aldehyde |
| IUPAC Name | pentanedial |
| Beilstein | 01, 776 |
| Molecular Formula | C5H8O2 |
| EINECS Number | 203-856-5 |
| Specific Gravity | 1.06 |
| CAS | 9010-66-6 |
|---|---|
| MDL Number | MFCD00062414 |
Glycerol monostearate, purified
CAS: 31566-31-1 Molecular Formula: C21H42O4 Molecular Weight (g/mol): 358.563 MDL Number: MFCD00036186 InChI Key: VBICKXHEKHSIBG-UHFFFAOYSA-N Synonym: glyceryl monostearate,monostearin,glyceryl stearate,1-stearoyl-rac-glycerol,tegin,1-monostearin,1-glyceryl stearate,glycerol monostearate,1-monostearoylglycerol,octadecanoic acid, 2,3-dihydroxypropyl ester PubChem CID: 24699 ChEBI: CHEBI:75555 IUPAC Name: 2,3-dihydroxypropyl octadecanoate SMILES: CCCCCCCCCCCCCCCCCC(=O)OCC(CO)O
| PubChem CID | 24699 |
|---|---|
| CAS | 31566-31-1 |
| Molecular Weight (g/mol) | 358.563 |
| ChEBI | CHEBI:75555 |
| MDL Number | MFCD00036186 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC(CO)O |
| Synonym | glyceryl monostearate,monostearin,glyceryl stearate,1-stearoyl-rac-glycerol,tegin,1-monostearin,1-glyceryl stearate,glycerol monostearate,1-monostearoylglycerol,octadecanoic acid, 2,3-dihydroxypropyl ester |
| IUPAC Name | 2,3-dihydroxypropyl octadecanoate |
| InChI Key | VBICKXHEKHSIBG-UHFFFAOYSA-N |
| Molecular Formula | C21H42O4 |
| Viscosity | 3.13 mPa.s (19°C) |
|---|---|
| Linear Formula | (CH3)4NOH |
| Molecular Weight (g/mol) | 91.15 |
| InChI Key | WGTYBPLFGIVFAS-UHFFFAOYSA-M |
| Density | 1.0140g/mL |
| PubChem CID | 60966 |
| Name Note | 25% in Water |
| Percent Purity | 23 to 27% |
| Fieser | 11,514 |
| RTECS Number | PA0875000 |
| Formula Weight | 91.15 |
| Melting Point | -25.0°C |
| Boiling Point | 102.0°C |
| Color | Colorless to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Tetramethylammonium hydroxide |
| SMILES | C[N+](C)(C)C.[OH-] |
| Merck Index | 15,9371 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Rinse mouth. IF IN EYES: Rinse cautiously with water for several minutes. Remove con |
| MDL Number | MFCD00008280 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Toxic if swallowed. Fatal in contact with skin. Causes damage to organs. Causes damage to organs through prolonged or repeated exposure. Toxic to aquatic life w |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Plastic bottle |
| Flash Point | >95°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.3780 to 1.3840 (20°C, 589nm) |
| Synonym | tetramethylammonium hydroxide,tmah,hydroxyde de tetramethylammonium,nmw-w,nmd 3,tetramethyl ammonium hydroxide,unii-5gkp7317q2,ammonium, tetramethyl-, hydroxide,methanaminium, n,n,n-trimethyl-, hydroxide,tetramethylammoniumhydroxide |
| TSCA | TSCA |
| IUPAC Name | tetramethylazanium;hydroxide |
| Beilstein | 04,5 |
| Molecular Formula | C4H13NO |
| EINECS Number | 200-882-9 |
| Specific Gravity | 1.014 |
| Linear Formula | (CH3)4NOH |
|---|---|
| Molecular Weight (g/mol) | 91.15 |
| InChI Key | WGTYBPLFGIVFAS-UHFFFAOYSA-M |
| Density | 1.0000g/mL |
| PubChem CID | 60966 |
| Name Note | 10% in Water |
| Percent Purity | 9.5 to 10.5% |
| Fieser | 11,514 |
| RTECS Number | PA0875000 |
| Formula Weight | 91.15 |
| Boiling Point | 100.0°C |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Tetramethylammonium hydroxide |
| SMILES | C[N+](C)(C)C.[OH-] |
| Merck Index | 15, 9371 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Do not breathe dust/fume/gas/mist/vapors/spray. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediat |
| MDL Number | MFCD00008280 |
| Health Hazard 2 | GHS H Statement Harmful if swallowed. Toxic in contact with skin. Causes severe skin burns and eye damage. |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetramethylammonium hydroxide,tmah,hydroxyde de tetramethylammonium,nmw-w,nmd 3,tetramethyl ammonium hydroxide,unii-5gkp7317q2,ammonium, tetramethyl-, hydroxide,methanaminium, n,n,n-trimethyl-, hydroxide,tetramethylammoniumhydroxide |
| TSCA | TSCA |
| IUPAC Name | tetramethylazanium;hydroxide |
| Beilstein | 04, 50 |
| Molecular Formula | C4H13NO |
| EINECS Number | 200-882-9 |
| Specific Gravity | 1 |
Casein, (Purified), MP Biomedicals
CAS: 9000-71-9 Molecular Formula: C81H125N22O39P Molecular Weight (g/mol): 2061.98 MDL Number: MFCD00081481 InChI Key: BECPQYXYKAMYBN-UHFFFAOYNA-N Synonym: casein,caseinogen,casein, tech.,bovine beta-casein monophosphopeptide PubChem CID: 73995022 IUPAC Name: 6-amino-2-{[2-({2-[(2-{[2-({2-[(2-{[2-({2-[(2-{[2-({2-[(2-{[2-({2-[(2-amino-1-hydroxy-3-phenylpropylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-1-hydroxy-3-(phosphonooxy)propylidene]amino}-4-carboxy-1-hydroxybutylidene)amino]-4-carboxy-1-hydroxybutylidene}amino)-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene]amino}-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-1,3-dihydroxybutylidene]amino}-4-carboxy-1-hydroxybutylidene)amino]-3-carboxy-1-hydroxypropylidene}amino)-4-carboxy-1-hydroxybutylidene]amino}-1-hydroxy-4-methylpentylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-3-carboxy-1-hydroxypropylidene]amino}hexanoic acid SMILES: CC(C)CC(N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1)C(C)O)C(O)=NC(CCC(O)=N)C(O)=NC(CC(O)=O)C(O)=NC(CCCCN)C(O)=O
| PubChem CID | 73995022 |
|---|---|
| CAS | 9000-71-9 |
| Molecular Weight (g/mol) | 2061.98 |
| MDL Number | MFCD00081481 |
| SMILES | CC(C)CC(N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1)C(C)O)C(O)=NC(CCC(O)=N)C(O)=NC(CC(O)=O)C(O)=NC(CCCCN)C(O)=O |
| Synonym | casein,caseinogen,casein, tech.,bovine beta-casein monophosphopeptide |
| IUPAC Name | 6-amino-2-{[2-({2-[(2-{[2-({2-[(2-{[2-({2-[(2-{[2-({2-[(2-{[2-({2-[(2-amino-1-hydroxy-3-phenylpropylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-1-hydroxy-3-(phosphonooxy)propylidene]amino}-4-carboxy-1-hydroxybutylidene)amino]-4-carboxy-1-hydroxybutylidene}amino)-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene]amino}-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-1,3-dihydroxybutylidene]amino}-4-carboxy-1-hydroxybutylidene)amino]-3-carboxy-1-hydroxypropylidene}amino)-4-carboxy-1-hydroxybutylidene]amino}-1-hydroxy-4-methylpentylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-3-carboxy-1-hydroxypropylidene]amino}hexanoic acid |
| InChI Key | BECPQYXYKAMYBN-UHFFFAOYNA-N |
| Molecular Formula | C81H125N22O39P |
Casein, ('Purified), MP Biomedicals
CAS: 9000-71-9 Molecular Formula: C81H125N22O39P Molecular Weight (g/mol): 2061.98 MDL Number: MFCD00081481 InChI Key: BECPQYXYKAMYBN-UHFFFAOYNA-N Synonym: casein,caseinogen,casein, tech.,bovine beta-casein monophosphopeptide PubChem CID: 73995022 IUPAC Name: 6-amino-2-{[2-({2-[(2-{[2-({2-[(2-{[2-({2-[(2-{[2-({2-[(2-{[2-({2-[(2-amino-1-hydroxy-3-phenylpropylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-1-hydroxy-3-(phosphonooxy)propylidene]amino}-4-carboxy-1-hydroxybutylidene)amino]-4-carboxy-1-hydroxybutylidene}amino)-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene]amino}-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-1,3-dihydroxybutylidene]amino}-4-carboxy-1-hydroxybutylidene)amino]-3-carboxy-1-hydroxypropylidene}amino)-4-carboxy-1-hydroxybutylidene]amino}-1-hydroxy-4-methylpentylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-3-carboxy-1-hydroxypropylidene]amino}hexanoic acid SMILES: CC(C)CC(N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1)C(C)O)C(O)=NC(CCC(O)=N)C(O)=NC(CC(O)=O)C(O)=NC(CCCCN)C(O)=O
| PubChem CID | 73995022 |
|---|---|
| CAS | 9000-71-9 |
| Molecular Weight (g/mol) | 2061.98 |
| MDL Number | MFCD00081481 |
| SMILES | CC(C)CC(N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1)C(C)O)C(O)=NC(CCC(O)=N)C(O)=NC(CC(O)=O)C(O)=NC(CCCCN)C(O)=O |
| Synonym | casein,caseinogen,casein, tech.,bovine beta-casein monophosphopeptide |
| IUPAC Name | 6-amino-2-{[2-({2-[(2-{[2-({2-[(2-{[2-({2-[(2-{[2-({2-[(2-{[2-({2-[(2-amino-1-hydroxy-3-phenylpropylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-1-hydroxy-3-(phosphonooxy)propylidene]amino}-4-carboxy-1-hydroxybutylidene)amino]-4-carboxy-1-hydroxybutylidene}amino)-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene]amino}-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-1,3-dihydroxybutylidene]amino}-4-carboxy-1-hydroxybutylidene)amino]-3-carboxy-1-hydroxypropylidene}amino)-4-carboxy-1-hydroxybutylidene]amino}-1-hydroxy-4-methylpentylidene)amino]-1-hydroxy-4-(C-hydroxycarbonimidoyl)butylidene}amino)-3-carboxy-1-hydroxypropylidene]amino}hexanoic acid |
| InChI Key | BECPQYXYKAMYBN-UHFFFAOYNA-N |
| Molecular Formula | C81H125N22O39P |
| Linear Formula | (C2H5)4NOH |
|---|---|
| Molecular Weight (g/mol) | 147.26 |
| InChI Key | LRGJRHZIDJQFCL-UHFFFAOYSA-M |
| Density | 1.0200g/mL |
| PubChem CID | 6509 |
| Name Note | 20 wt.% in Water |
| Percent Purity | ≥20% |
| RTECS Number | KH3150000 |
| Formula Weight | 147.26 |
| Boiling Point | 102.0°C |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Tetraethylammonium hydroxide |
| SMILES | [OH-].CC[N+](CC)(CC)CC |
| Merck Index | 15, 9346 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00009024 |
| Health Hazard 2 | GHS H Statement May be corrosive to metals. Causes severe skin burns and eye damage. Toxic if swallowed. Causes damage to organs if swallowed. Causes damage to organs through prolonged or repeated exposure in contact with s |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.402 |
| Synonym | tetraethylammonium hydroxide,tetraethyl ammonium hydroxide,unii-ra8vu41b1f,ammonium, tetraethyl-, hydroxide,tetraethylazanium hydroxide,ethanaminium, n,n,n-triethyl-, hydroxide,ra8vu41b1f,ethanaminium, n,n,n-triethyl-, hydroxide 1:1,tetraethylammonium hydroxide solution in water,n,n,n-triethylethanaminium |
| TSCA | TSCA |
| IUPAC Name | tetraethylazanium;hydroxide |
| Molecular Formula | C8H21NO |
| EINECS Number | 201-073-3 |
| Specific Gravity | 1.02 |
Tetrabutylammonium fluoride, 75% solution in water
CAS: 429-41-4 Molecular Formula: C16H36FN Molecular Weight (g/mol): 261.47 MDL Number: MFCD00011747 InChI Key: FPGGTKZVZWFYPV-UHFFFAOYSA-M Synonym: tetrabutylammonium fluoride,tbaf,tetrabutylazanium fluoride,tetrabutyl ammonium fluoride,tetra-n-butylammonium fluoride,tetrabutylamine, fluoride,n,n,n-tributylbutan-1-aminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride,n,n,n-tributyl-1-butanaminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride 1:1 PubChem CID: 2724141 ChEBI: CHEBI:51990 SMILES: [F-].CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 2724141 |
|---|---|
| CAS | 429-41-4 |
| Molecular Weight (g/mol) | 261.47 |
| ChEBI | CHEBI:51990 |
| MDL Number | MFCD00011747 |
| SMILES | [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium fluoride,tbaf,tetrabutylazanium fluoride,tetrabutyl ammonium fluoride,tetra-n-butylammonium fluoride,tetrabutylamine, fluoride,n,n,n-tributylbutan-1-aminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride,n,n,n-tributyl-1-butanaminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride 1:1 |
| InChI Key | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| Molecular Formula | C16H36FN |
Dibenzoyl peroxide, 75%, remainder water
CAS: 94-36-0 Molecular Formula: C14H10O4 Molecular Weight (g/mol): 242.23 MDL Number: MFCD00003071 InChI Key: OMPJBNCRMGITSC-UHFFFAOYSA-N Synonym: benzoyl peroxide,dibenzoyl peroxide,peroxide, dibenzoyl,benzoperoxide,benzoyl superoxide,acetoxyl,lucidol,benoxyl,panoxyl,benzol peroxide PubChem CID: 7187 ChEBI: CHEBI:82405 IUPAC Name: benzoyl benzenecarboperoxoate SMILES: C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2
| PubChem CID | 7187 |
|---|---|
| CAS | 94-36-0 |
| Molecular Weight (g/mol) | 242.23 |
| ChEBI | CHEBI:82405 |
| MDL Number | MFCD00003071 |
| SMILES | C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2 |
| Synonym | benzoyl peroxide,dibenzoyl peroxide,peroxide, dibenzoyl,benzoperoxide,benzoyl superoxide,acetoxyl,lucidol,benoxyl,panoxyl,benzol peroxide |
| IUPAC Name | benzoyl benzenecarboperoxoate |
| InChI Key | OMPJBNCRMGITSC-UHFFFAOYSA-N |
| Molecular Formula | C14H10O4 |
Morpholine, 99.5%, purified by redistillation, AcroSeal™
CAS: 110-91-8 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00005972 InChI Key: YNAVUWVOSKDBBP-UHFFFAOYSA-N Synonym: 1-oxa-4-azacyclohexane,tetrahydro-1,4-oxazine,diethylene oximide,diethylenimide oxide,diethyleneimide oxide,drewamine,diethylene imidoxide,tetrahydro-p-oxazine,tetrahydro-2h-1,4-oxazine,p-isoxazine, tetrahydro PubChem CID: 8083 ChEBI: CHEBI:34856 IUPAC Name: morpholine SMILES: C1COCCN1
| PubChem CID | 8083 |
|---|---|
| CAS | 110-91-8 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:34856 |
| MDL Number | MFCD00005972 |
| SMILES | C1COCCN1 |
| Synonym | 1-oxa-4-azacyclohexane,tetrahydro-1,4-oxazine,diethylene oximide,diethylenimide oxide,diethyleneimide oxide,drewamine,diethylene imidoxide,tetrahydro-p-oxazine,tetrahydro-2h-1,4-oxazine,p-isoxazine, tetrahydro |
| IUPAC Name | morpholine |
| InChI Key | YNAVUWVOSKDBBP-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Pyrrolidine, 99.5+%, purified by redistillation, AcroSeal™
CAS: 123-75-1 Molecular Formula: C4H9N Molecular Weight (g/mol): 71.12 MDL Number: MFCD00005249 InChI Key: RWRDLPDLKQPQOW-UHFFFAOYSA-N Synonym: tetrahydropyrrole,tetrahydro pyrrole,azacyclopentane,azolidine,tetramethylenimine,butylenimine,perhydropyrrole,prolamine,1-azacyclopentane,tetramethyleneimine PubChem CID: 31268 ChEBI: CHEBI:33135 IUPAC Name: pyrrolidine SMILES: C1CCNC1
| PubChem CID | 31268 |
|---|---|
| CAS | 123-75-1 |
| Molecular Weight (g/mol) | 71.12 |
| ChEBI | CHEBI:33135 |
| MDL Number | MFCD00005249 |
| SMILES | C1CCNC1 |
| Synonym | tetrahydropyrrole,tetrahydro pyrrole,azacyclopentane,azolidine,tetramethylenimine,butylenimine,perhydropyrrole,prolamine,1-azacyclopentane,tetramethyleneimine |
| IUPAC Name | pyrrolidine |
| InChI Key | RWRDLPDLKQPQOW-UHFFFAOYSA-N |
| Molecular Formula | C4H9N |
Methanesulfonic acid, pure, 70% solution in water
CAS: 75-75-2 Molecular Formula: CH4O3S Molecular Weight (g/mol): 96.1 MDL Number: MFCD00007518 InChI Key: AFVFQIVMOAPDHO-UHFFFAOYSA-N Synonym: methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane PubChem CID: 6395 ChEBI: CHEBI:27376 IUPAC Name: methanesulfonic acid SMILES: CS(=O)(=O)O
| PubChem CID | 6395 |
|---|---|
| CAS | 75-75-2 |
| Molecular Weight (g/mol) | 96.1 |
| ChEBI | CHEBI:27376 |
| MDL Number | MFCD00007518 |
| SMILES | CS(=O)(=O)O |
| Synonym | methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane |
| IUPAC Name | methanesulfonic acid |
| InChI Key | AFVFQIVMOAPDHO-UHFFFAOYSA-N |
| Molecular Formula | CH4O3S |
| Viscosity | 20 mPa.s (50°C) |
|---|---|
| Linear Formula | OHC(CH2)3CHO |
| Molecular Weight (g/mol) | 100.12 |
| ChEBI | CHEBI:64276 |
| InChI Key | SXRSQZLOMIGNAQ-UHFFFAOYSA-N |
| Density | 1.1300g/mL |
| PubChem CID | 3485 |
| Name Note | 50 wt% Solution in Water |
| Fieser | 01,411 |
| pH | 3.2 to 4.2 |
| Formula Weight | 100.12 |
| Melting Point | -33.0°C |
| Boiling Point | 101.5°C (740.0 mmHg) |
| Physical Form | Solution |
| Chemical Name or Material | Glutaric dialdehyde |
| SMILES | O=CCCCC=O |
| Merck Index | 15, 4508 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. IF IN EYES: Rinse cautiously with water for several minu |
| MDL Number | MFCD00007025 |
| Health Hazard 2 | GHS H Statement Toxic if swallowed. Fatal if inhaled. Causes severe skin burns and eye damage. May cause allergy or asthma symptoms or breathing difficulties if inhaled. May cause an allergic skin reaction. Very toxic |
| Solubility Information | Solubility in water: soluble |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | glutaraldehyde,glutaral,glutaric dialdehyde,cidex,glutardialdehyde,1,5-pentanedial,sonacide,glutarol,aldesan,glutaric aldehyde |
| IUPAC Name | pentanedial |
| Beilstein | 01, 776 |
| Molecular Formula | C5H8O2 |
| EINECS Number | 203-856-5 |
| Specific Gravity | 1.13 |
Glyoxime, 98+%, moistened with ca 20% water
CAS: 557-30-2 Molecular Formula: C2H4N2O2 Molecular Weight (g/mol): 88.066 MDL Number: MFCD00013942 InChI Key: RUFIRPVAEJIIIS-OWOJBTEDSA-N Synonym: glyoxime,ethanedial, dioxime,ethanedione dioxime,pik-off,glyoxaldioxime,glyoxal dioxime,ethanedial dioxime,glyoxal-dioxime,dioxime ethanedial,glyoxal, dioxime PubChem CID: 5354753 IUPAC Name: N-[(E)-2-nitrosoethenyl]hydroxylamine SMILES: C(=CN=O)NO
| PubChem CID | 5354753 |
|---|---|
| CAS | 557-30-2 |
| Molecular Weight (g/mol) | 88.066 |
| MDL Number | MFCD00013942 |
| SMILES | C(=CN=O)NO |
| Synonym | glyoxime,ethanedial, dioxime,ethanedione dioxime,pik-off,glyoxaldioxime,glyoxal dioxime,ethanedial dioxime,glyoxal-dioxime,dioxime ethanedial,glyoxal, dioxime |
| IUPAC Name | N-[(E)-2-nitrosoethenyl]hydroxylamine |
| InChI Key | RUFIRPVAEJIIIS-OWOJBTEDSA-N |
| Molecular Formula | C2H4N2O2 |