missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Uridine 5'-monophosphate, disodium salt, hydrate, 98%, Thermo Scientific™
homogeneous
Supplier: Thermo Scientific Chemicals 226290050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Uridine 5′-monophosphate, disodium salt, hydrate | |
| 0.71 to 0.77 (A250/A260),0.38 to 0.44 (A280/A260) | |
| 97.5% min. (HPLC) | |
| C9H11N2Na2O9P·xH2O | |
| 5g | |
| uridine-5'-monophosphate disodium salt, uridine 5'-monophosphate, disodium salt, 5'-uridylicaciddisodiumsalt | |
| 97.5% min. (lambda max. 262nm,pH 7) molar absorptivity 10000+/-2%,on dry basis | |
| C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)O)O)O.[Na].[Na] | |
| 95% min. (c=1, 430nm) 1cm cell | |
| 123134060 | |
| 98% |
| 3387-36-8 | |
| Authentic | |
| Glass bottle | |
| MFCD00149422 | |
| 10, 9689 | |
| Solubility in water:+/- 40% (20°C) | |
| RSSRHKDOIOBLBS-WFIJOQBCSA-N | |
| [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;sodium | |
| 368.14 | |
| 368.14 |
Chemical Identifiers
| 3387-36-8 | |
| 368.14 | |
| RSSRHKDOIOBLBS-WFIJOQBCSA-N | |
| 123134060 | |
| C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)O)O)O.[Na].[Na] |
| C9H11N2Na2O9P·xH2O | |
| MFCD00149422 | |
| uridine-5'-monophosphate disodium salt, uridine 5'-monophosphate, disodium salt, 5'-uridylicaciddisodiumsalt | |
| [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;sodium |
Safety and Handling
EINECSNumber : 222-211-9
RUO â Research Use Only