missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Uranine (Concentrated, Water Soluble/Laboratory), Fisher Chemical™
Used by nuclear utilities to test cooling systems for small leaks
Supplier: Thermo Fisher Scientific FLA833500
Specifications
| Uranine | |
| 518-47-8 | |
| MFCD00167039 | |
| Pass Test | |
| [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=CC(=O)C=C2OC2=CC([O-])=CC=C12 | |
| 376.28 | |
| Laboratory | |
| Orange | |
| Powder |
| 320°C | |
| C20H10Na2O5 | |
| Fluorescein Sodium Salt | |
| NJDNXYGOVLYJHP-UHFFFAOYSA-L | |
| disodium 2-(6-oxido-3-oxo-3H-xanthen-9-yl)benzoate | |
| 376.28 | |
| Poly Bottle | |
| 500 g |
Chemical Identifiers
| 518-47-8 | |
| 376.28 | |
| NJDNXYGOVLYJHP-UHFFFAOYSA-L | |
| disodium 2-(6-oxido-3-oxo-3H-xanthen-9-yl)benzoate |
| C20H10Na2O5 | |
| MFCD00167039 | |
| Fluorescein Sodium Salt | |
| [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=CC(=O)C=C2OC2=CC([O-])=CC=C12 |
Safety and Handling