missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ UDP-α-D-N-Acetylglucosamine, Disodium Salt, >95% Calbiochem™,
Donor substrate for N-acetylglucosaminyltransferases. Useful in the synthesis of aryl azide derivatives that can be used in the affinity labeling of glycosyltransferase and UDP-HexNAc pyrophosphorylase
Supplier: MilliporeSigma™ 67010750MG
Spécifications
| UDP-α-D-N-Acetylglucosamine, Disodium Salt | |
| White | |
| 50 mg | |
| Easily soluble in cold water | |
| CC(=O)NC1C(C(C(OC1OP(=O)(O)OP(=O)(O)OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O)CO)O)O.[Na].[Na] | |
| 653.334 | |
| 651.3 | |
| Solid |
| 91183-98-1 | |
| C17H27N3Na2O17P2 | |
| uridine 5'-diphospho-n-acetyl-*glucosamine sodium | |
| QPWKUQXSMYTKRZ-YZVFIFBQSA-N | |
| [(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate;sodium | |
| 131863333 | |
| HPLC |
Identifiants chimiques
| 91183-98-1 | |
| 653.334 | |
| uridine 5'-diphospho-n-acetyl-*glucosamine sodium | |
| [(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate;sodium |
| C17H27N3Na2O17P2 | |
| QPWKUQXSMYTKRZ-YZVFIFBQSA-N | |
| 131863333 | |
| CC(=O)NC1C(C(C(OC1OP(=O)(O)OP(=O)(O)OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O)CO)O)O.[Na].[Na] |
Sécurité et manipulation
Recommended Storage : Keep container tightly closed. Keep container in a cool, well-ventilated area. Do not store above -20°C (-4°F).