missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triton™ X-100, Molecular Biology Reagent Grade, MP Biomedicals™
Supplier: MP Biomedicals Inc 0219485450
| Quantity | 50 mL |
|---|
Chemical Identifiers
| C16H26O2 | |
| MFCD00132505 | |
| 4-(1,1,3,3-Tetramethylbutyl)phenyl-polyethylene glycol, 4-(1, 1, 3 | |
| 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethan-1-ol |
Specifications
| Triton™ X-100 | |
| 9002-93-1 | |
| 8.9 lb./gal. | |
| C16H26O2 | |
| 4-(1,1,3,3-Tetramethylbutyl)phenyl-polyethylene glycol, 4-(1, 1, 3 | |
| CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 | |
| 250.38 | |
| Molecular Biology |
| Colorless to Yellow | |
| Viscous Liquid | |
| 50 mL | |
| MFCD00132505 | |
| JYCQQPHGFMYQCF-UHFFFAOYSA-N | |
| 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethan-1-ol | |
| 5590 |
Safety and Handling
Recommended Storage : Store at room temperature (15° to 30°C)