missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ Triton™X-100 Surfactant, OmniPur™, Calbiochem™,
Used for solubilization of membrane proteins, enzymology, analytical and diagnostic work, as well as chromatography and electrophoresis
Supplier: MilliporeSigma™ 9400100ML
| Quantity | 100 mL |
|---|---|
| Packaging | Glass Bottle |
Description
Recommended Storage
Ok to freeze
Chemical Identifiers
| 9002-93-1 | |
| 250.38 | |
| JYCQQPHGFMYQCF-UHFFFAOYSA-N | |
| 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethan-1-ol |
| C16H26O2 | |
| MFCD00132505 | |
| 5590 | |
| CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 |
Specifications
| Undesignated | |
| Viscous liquid | |
| 100 mL | |
| C16H26O2 | |
| MFCD00132505 | |
| CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 | |
| 250.38 | |
| Molecular Biology |
| 9002-93-1 | |
| 6.0 to 8.0 | |
| Glass Bottle | |
| <0.5% | |
| JYCQQPHGFMYQCF-UHFFFAOYSA-N | |
| 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethan-1-ol | |
| 5590 |
Safety and Handling
storageNote1 : Ok to freeze