missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triphenyltin chloride, 95%
CAS: 639-58-7 | C18H17ClSn | 387.49 g/mol
$103.34 - $103.34
Chemical Identifiers
| CAS | 639-58-7 |
|---|---|
| Molecular Formula | C18H17ClSn |
| Molecular Weight (g/mol) | 387.49 |
| MDL Number | MFCD00000519 |
| InChI Key | ZDYYCRIXXMWWQC-UHFFFAOYSA-N |
| Synonym | triphenyltin chloride, fentin chloride, chlorotriphenyltin, triphenylchlorotin, stannane, chlorotriphenyl, brestanol, tptc, triphenylchlorostannane, aquatin, tinmate |
| PubChem CID | 12540 |
| ChEBI | CHEBI:35036 |
| IUPAC Name | chloro(triphenyl)stannane |
| SMILES | Cl.C1=CC=C(C=C1)[SnH](C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC317291000
|
Thermo Scientific Chemicals
317291000 |
100 g | Glass bottle |
Each for $103.34
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 639-58-7 | |
| 387.49 | |
| ZDYYCRIXXMWWQC-UHFFFAOYSA-N | |
| 12540 | |
| chloro(triphenyl)stannane |
| C18H17ClSn | |
| MFCD00000519 | |
| triphenyltin chloride, fentin chloride, chlorotriphenyltin, triphenylchlorotin, stannane, chlorotriphenyl, brestanol, tptc, triphenylchlorostannane, aquatin, tinmate | |
| CHEBI:35036 | |
| Cl.C1=CC=C(C=C1)[SnH](C1=CC=CC=C1)C1=CC=CC=C1 |
Specifications
| 639-58-7 | |
| White | |
| Authentic | |
| Glass bottle | |
| (C6H5)3SnCl | |
| 100 g | |
| Solubility in water: insoluble. | |
| Cl.C1=CC=C(C=C1)[SnH](C1=CC=CC=C1)C1=CC=CC=C1 | |
| 387.49 | |
| CHEBI:35036 | |
| 95% | |
| Triphenyltin chloride |
| 103.0°C to 108.0°C | |
| 240.0°C (13.5 mmHg) | |
| 94% min. (Argentometry) | |
| C18H17ClSn | |
| MFCD00000519 | |
| triphenyltin chloride, fentin chloride, chlorotriphenyltin, triphenylchlorotin, stannane, chlorotriphenyl, brestanol, tptc, triphenylchlorostannane, aquatin, tinmate | |
| ZDYYCRIXXMWWQC-UHFFFAOYSA-N | |
| chloro(triphenyl)stannane | |
| 12540 | |
| 385.47 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Toxic in contact with skin.
Toxic if swallowed.
Very toxic to aquatic life with long lasting effects.
Toxic if inhaled.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing/eye protection/face protection.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN:
GHS Signal Word: Danger
EINECSNumber : 211-358-4
RUO – Research Use Only