Learn More
Triphenyl phosphate, 99+%
CAS: 115-86-6 | C18H15O4P | 326.29 g/mol
$75.10 - $276.51
Chemical Identifiers
| CAS | 115-86-6 |
|---|---|
| Molecular Formula | C18H15O4P |
| Molecular Weight (g/mol) | 326.29 |
| MDL Number | MFCD00003031 |
| InChI Key | XZZNDPSIHUTMOC-UHFFFAOYSA-N |
| Synonym | triphenylphosphate, phosphoric acid, triphenyl ester, disflamoll tp, triphenoxyphosphine oxide, celluflex tpp, phosflex tpp, trifenylfosfat, phenyl phosphate pho 3po, phosphoric acid triphenyl ester, trifenylfosfat czech |
| PubChem CID | 8289 |
| ChEBI | CHEBI:35033 |
| IUPAC Name | triphenyl phosphate |
| SMILES | O=P(OC1=CC=CC=C1)(OC1=CC=CC=C1)OC1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC147672500
|
Thermo Scientific Chemicals
147672500 |
250 g | Plastic bottle |
Each for $75.10
|
|
||||
|
AC147670025
|
Thermo Scientific Chemicals
147670025 |
2.5 kg | Plastic bottle |
Each for $276.51
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Suitable for battery materials development.
Chemical Identifiers
| 115-86-6 | |
| 326.29 | |
| XZZNDPSIHUTMOC-UHFFFAOYSA-N | |
| 8289 | |
| triphenyl phosphate |
| C18H15O4P | |
| MFCD00003031 | |
| triphenylphosphate, phosphoric acid, triphenyl ester, disflamoll tp, triphenoxyphosphine oxide, celluflex tpp, phosflex tpp, trifenylfosfat, phenyl phosphate pho 3po, phosphoric acid triphenyl ester, trifenylfosfat czech | |
| CHEBI:35033 | |
| O=P(OC1=CC=CC=C1)(OC1=CC=CC=C1)OC1=CC=CC=C1 |
Specifications
| 115-86-6 | |
| 47°C to 53°C | |
| 370°C | |
| Authentic | |
| Plastic bottle | |
| (C6H5O)3P(O) | |
| 250 g | |
| 15, 9915 | |
| Solubility in water: insoluble. Other solubilities: soluble in ethanol and acetone | |
| O=P(OC1=CC=CC=C1)(OC1=CC=CC=C1)OC1=CC=CC=C1 | |
| 326.29 | |
| CHEBI:35033 | |
| 99+% | |
| Triphenyl phosphate |
| 0.05mg KOH/g max. | |
| White | |
| 220°C | |
| 99% min. (GC) | |
| C18H15O4P | |
| MFCD00003031 | |
| 06, 179 | |
| triphenylphosphate, phosphoric acid, triphenyl ester, disflamoll tp, triphenoxyphosphine oxide, celluflex tpp, phosflex tpp, trifenylfosfat, phenyl phosphate pho 3po, phosphoric acid triphenyl ester, trifenylfosfat czech | |
| XZZNDPSIHUTMOC-UHFFFAOYSA-N | |
| triphenyl phosphate | |
| 8289 | |
| 326.28 | |
| Crystalline Flakes |
Safety and Handling
GHS H Statement
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Avoid release to the environment.
Collect spillage.
Dispose of contents/container to an approved waste disposal plant.
GHS Signal Word: Warning
EINECSNumber : 204-112-2
RUO – Research Use Only