Learn More
Trifluoromethanesulfonic anhydride, 98+%
Trifluoromethanesulfonic anhydride, 98+%, Quantity: 250mL, Packaging: Glass bottle, Boiling Point: 80.0 deg.C, Colorless to Brown, Molecular Weight: 282.13, Percent Purity: 98+%, Assay Percent Range: 98+%, Beilstein: 03, IV, 35, CAS: 358-23-6, ChEBI: CHEBI:48509, Density: 1.7000g/mL | CAS: 358-23-6 | C2F6O5S2 | 282.13 g/mol
$702.26 - $702.26
Chemical Identifiers
| CAS | 358-23-6 |
|---|---|
| MDL Number | MFCD00000408 |
| InChI Key | WJKHJLXJJJATHN-UHFFFAOYSA-N |
| Synonym | trifluoromethanesulfonic anhydride, triflic anhydride, trifluoromethanesulphonic anhydride, trifluoromethanesulfonic acid anhydride, methanesulfonic acid, trifluoro-, anhydride, trifluoromethanesulphonic acid anhydride, unii-8w034lhg1u, tf2o, trifluoromethane sulfonyl trifluoromethanesulfonate, trifluoromethane sulfonic anhydride |
| PubChem CID | 67749 |
| ChEBI | CHEBI:48509 |
| IUPAC Name | trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC175060500
|
Thermo Scientific Chemicals
175060500 |
50 mL | Glass bottle |
Each for $702.26
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Alkylation reagent, Coupling reagentChemical Identifiers
| 358-23-6 | |
| WJKHJLXJJJATHN-UHFFFAOYSA-N | |
| 67749 | |
| trifluoromethylsulfonyl trifluoromethanesulfonate |
| MFCD00000408 | |
| trifluoromethanesulfonic anhydride, triflic anhydride, trifluoromethanesulphonic anhydride, trifluoromethanesulfonic acid anhydride, methanesulfonic acid, trifluoro-, anhydride, trifluoromethanesulphonic acid anhydride, unii-8w034lhg1u, tf2o, trifluoromethane sulfonyl trifluoromethanesulfonate, trifluoromethane sulfonic anhydride | |
| CHEBI:48509 | |
| C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F |
Specifications
| 358-23-6 | |
| 1.7000g/mL | |
| Authentic | |
| Glass bottle | |
| 1.3200 to 1.3230 | |
| MFCD00000408 | |
| 03, IV, 35 | |
| 1.7 | |
| trifluoromethanesulfonic anhydride, triflic anhydride, trifluoromethanesulphonic anhydride, trifluoromethanesulfonic acid anhydride, methanesulfonic acid, trifluoro-, anhydride, trifluoromethanesulphonic acid anhydride, unii-8w034lhg1u, tf2o, trifluoromethane sulfonyl trifluoromethanesulfonate, trifluoromethane sulfonic anhydride | |
| WJKHJLXJJJATHN-UHFFFAOYSA-N | |
| trifluoromethylsulfonyl trifluoromethanesulfonate | |
| 67749 | |
| 282.13 | |
| Liquid |
| Colorless to Brown | |
| 80.0°C | |
| 98+% | |
| C2F6O5S2 | |
| (CF3SO2)2O | |
| 50 mL | |
| 04,533; 05,702; 06,618; 07,390; 10,419; 11,560; 12,532; 14,324; 15,339; 16,357; 17,156 | |
| 15, 9850 | |
| Solubility in water: reacts viontly with water | |
| C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F | |
| 282.13 | |
| CHEBI:48509 | |
| 98+% | |
| Trifluoromethanesulfonic anhydride |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes severe skin burns and eye damage.
Reacts violently with water.
May be corrosive to metals.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove
GHS Signal Word: Danger
EINECSNumber : 206-616-8
RUO – Research Use Only