Learn More
Trifluoroacetic anhydride, 99+%
Trifluoroacetic anhydride, 99+%, Quantity: 500g, Packaging: Glass Bottle, Boiling Point: 39.1 deg.C, Undesignated, Melting Point: -63.5 deg.C, Molecular Weight: 210.03, Percent Purity: 99+%, Assay Percent Range: 99% min. (GC), Beilstein: 02, II, 186, CAS: 407-25-0 | CAS: 407-25-0 | C4F6O3 | 210.03 g/mol
Supplier: Thermo Scientific Chemicals 147815000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Acylation reagentSpecifications
| Trifluoroacetic anhydride | |
| -63.5°C | |
| 39.1°C | |
| 99% min. (GC) | |
| C4F6O3 | |
| (CF3CO)2O | |
| 500 g | |
| 01,1221; 03,308; 05,701; 06,616; 07,389; 09,484; 12,530; 14,151; 15,14; 01,373 | |
| trifluoroacetic anhydride, trifluoroacetic acid anhydride, 2,2,2-trifluoroacetic anhydride, bis trifluoroacetic anhydride, acetic acid, trifluoro-, anhydride, perfluoroacetic anhydride, trifluoroacetyl anhydride, tfaa, hexafluoroacetic anhydride, anhydrid kyseliny trifluoroctove | |
| QAEDZJGFFMLHHQ-UHFFFAOYSA-N | |
| (2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate | |
| 9845 | |
| 141mbar at 20°C | |
| Liquid |
| 407-25-0 | |
| 1.5100g/mL | |
| Authentic | |
| Glass Bottle | |
| 1.3 | |
| MFCD00000416 | |
| 02, II, 186 | |
| 1.51 | |
| Solubility in water: hydrolysis. Other solubilities: miscible with polar organic solvents, partically soluble in unpolar hydrocarbons | |
| FC(F)(F)C(=O)OC(=O)C(F)(F)F | |
| 210.03 | |
| 210.03 | |
| 99+% |
Chemical Identifiers
| 407-25-0 | |
| 210.03 | |
| QAEDZJGFFMLHHQ-UHFFFAOYSA-N | |
| 9845 | |
| FC(F)(F)C(=O)OC(=O)C(F)(F)F |
| C4F6O3 | |
| MFCD00000416 | |
| trifluoroacetic anhydride, trifluoroacetic acid anhydride, 2,2,2-trifluoroacetic anhydride, bis trifluoroacetic anhydride, acetic acid, trifluoro-, anhydride, perfluoroacetic anhydride, trifluoroacetyl anhydride, tfaa, hexafluoroacetic anhydride, anhydrid kyseliny trifluoroctove | |
| (2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
Safety and Handling
GHS H Statement
Harmful if inhaled.
Harmful to aquatic life with long lasting effects.
Causes severe skin burns and eye damage.
Reacts violently with water.
GHS P Statement
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minu
GHS Signal Word: Danger
EINECSNumber : 206-982-9
RUO – Research Use Only