Learn More
Triflumuron, 98+%, Thermo Scientific Chemicals
Triflumuron acts as a chitin synthesis inhibitor and prevents uridine incorporation into RNA
Supplier: Thermo Scientific Chemicals J6311222
Description
Triflumuron acts as a chitin synthesis inhibitor and prevents uridine incorporation into RNA
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Triflumuron | |
| 198°C | |
| MFCD00072496 | |
| 2776684 | |
| triflumuron, alsystin, trifluron, mascot, alsystine, triflumuron iso, caswell no. 217c, bay-sir 8514, unii-3ft64dyg8k, bay-vi 7533 | |
| XAIPTRIXGHTTNT-UHFFFAOYSA-N | |
| 2-chloro-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]benzamide | |
| 47445 | |
| 358.7 | |
| Solid |
| 64628-44-0 | |
| C15H10ClF3N2O3 | |
| 100 g | |
| 14,9678 | |
| Soluble in DMF | |
| C1=CC=C(C(=C1)C(=O)NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)Cl | |
| 358.701 | |
| CHEBI:39388 | |
| ≥98% |
Chemical Identifiers
| 64628-44-0 | |
| 358.701 | |
| XAIPTRIXGHTTNT-UHFFFAOYSA-N | |
| 47445 | |
| 2-chloro-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]benzamide |
| C15H10ClF3N2O3 | |
| MFCD00072496 | |
| triflumuron, alsystin, trifluron, mascot, alsystine, triflumuron iso, caswell no. 217c, bay-sir 8514, unii-3ft64dyg8k, bay-vi 7533 | |
| CHEBI:39388 | |
| C1=CC=C(C(=C1)C(=O)NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)Cl |
Safety and Handling
EINECSNumber : 264-980-3
RTECSNumber : CV2474000
TSCA : No
Recommended Storage : Ambient temperatures
RUO – Research Use Only