missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triethyl citrate, 99%
CAS: 77-93-0 | C12H20O7 | 276.29 g/mol
$99.17 - $473.81
Chemical Identifiers
| CAS | 77-93-0 |
|---|---|
| Molecular Formula | C12H20O7 |
| Molecular Weight (g/mol) | 276.29 |
| InChI Key | DOOTYTYQINUNNV-UHFFFAOYSA-N |
| Synonym | triethyl citrate, ethyl citrate, citroflex 2, eudraflex, hydragen cat, citric acid, triethyl ester, triaethylcitrat, triethylcitrate, citric acid triethyl ester, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester |
| PubChem CID | 6506 |
| IUPAC Name | triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC375062500
|
Thermo Scientific Chemicals
375062500 |
250 g | Plastic bottle |
Each for $99.17
|
|
||||
|
AC375060010
|
Thermo Scientific Chemicals
375060010 |
1 kg | Plastic bottle |
Each for $193.70
|
|
||||
|
AC375060025
|
Thermo Scientific Chemicals
375060025 |
2.5 kg | Plastic bottle |
Each for $473.81
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 77-93-0 | |
| 276.29 | |
| triethyl citrate, ethyl citrate, citroflex 2, eudraflex, hydragen cat, citric acid, triethyl ester, triaethylcitrat, triethylcitrate, citric acid triethyl ester, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester | |
| triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| C12H20O7 | |
| DOOTYTYQINUNNV-UHFFFAOYSA-N | |
| 6506 | |
| CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |
Specifications
| 77-93-0 | |
| 1.1360g/mL | |
| 151°C | |
| 98.5% min. (GC) | |
| C12H20O7 | |
| 250 g | |
| 15,2325 | |
| Solubility in water: 5.7% (25°C) | |
| CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O | |
| 276.29 | |
| 35.2 mPa.s (25°C) | |
| 99% | |
| Triethyl citrate |
| -46.0°C | |
| 294.0°C | |
| Authentic | |
| Plastic bottle | |
| 1.4400 to 1.4430 | |
| 1.136 | |
| triethyl citrate, ethyl citrate, citroflex 2, eudraflex, hydragen cat, citric acid, triethyl ester, triaethylcitrat, triethylcitrate, citric acid triethyl ester, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester | |
| DOOTYTYQINUNNV-UHFFFAOYSA-N | |
| triethyl 2-hydroxypropane-1,2,3-tricarboxylate | |
| 6506 | |
| 276.29 | |
| Liquid |
Safety and Handling
EINECSNumber : 201-070-7
RUO – Research Use Only